missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Perylene, 99+%
CAS: 198-55-0 | C20H12 | 252.31 g/mol
$91.73 - $91.73
Chemical Identifiers
| CAS | 198-55-0 |
|---|---|
| Molecular Formula | C20H12 |
| Molecular Weight (g/mol) | 252.31 |
| MDL Number | MFCD00004142 |
| InChI Key | CSHWQDPOILHKBI-UHFFFAOYSA-N |
| Synonym | peri-dinaphthalene, perilene, dibenz de,kl anthracene, alpha-perylene, perylen, unii-5qd5427un7, ccris 1231, perylen-1-yl, perylen-2-yl |
| PubChem CID | 9142 |
| ChEBI | CHEBI:29861 |
| IUPAC Name | perylene |
| SMILES | C1=CC2=C3C(=C1)C4=CC=CC5=C4C(=CC=C5)C3=CC=C2 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC130070010
|
Thermo Scientific Chemicals
130070010 |
1 g | Glass bottle |
Each for $91.73
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 198-55-0 | |
| 252.31 | |
| CSHWQDPOILHKBI-UHFFFAOYSA-N | |
| 9142 | |
| perylene |
| C20H12 | |
| MFCD00004142 | |
| peri-dinaphthalene, perilene, dibenz de,kl anthracene, alpha-perylene, perylen, unii-5qd5427un7, ccris 1231, perylen-1-yl, perylen-2-yl | |
| CHEBI:29861 | |
| C1=CC2=C3C(=C1)C4=CC=CC5=C4C(=CC=C5)C3=CC=C2 |
Specifications
| 198-55-0 | |
| Ochre to Brown | |
| 99% min. (HPLC) | |
| C20H12 | |
| 1 g | |
| 15, 7299 | |
| Solubility in water: insoluble. Other solubilities: slightly soluble in ether, alcohol,, soluble in benzene, toluene,, very soluble in cs2, chloroform, acetone, very sparingly soluble in petroleum ether | |
| C1=CC2=C3C(=C1)C4=CC=CC5=C4C(=CC=C5)C3=CC=C2 | |
| 252.31 | |
| CHEBI:29861 | |
| 99+% | |
| Perylene |
| 277.0°C to 280.0°C | |
| Authentic | |
| Glass bottle | |
| MFCD00004142 | |
| 05, I, 363 | |
| peri-dinaphthalene, perilene, dibenz de,kl anthracene, alpha-perylene, perylen, unii-5qd5427un7, ccris 1231, perylen-1-yl, perylen-2-yl | |
| CSHWQDPOILHKBI-UHFFFAOYSA-N | |
| perylene | |
| 9142 | |
| 252.31 | |
| Powder |
Safety and Handling
EINECSNumber : 205-900-9
RUO – Research Use Only