Learn More
Perfluorodecalin, 90%, mixture of cis and trans, Thermo Scientific Chemicals
$116.00 - $1567.41
Chemical Identifiers
| CAS | 306-94-5 |
|---|---|
| Molecular Formula | C10F18 |
| Molecular Weight (g/mol) | 462.08 |
| MDL Number | MFCD00010626 |
| InChI Key | UWEYRJFJVCLAGH-UHFFFAOYSA-N |
| Synonym | perfluorodecalin, perflunafene, octadecafluorodecahydronaphthalene, cis-perfluorodecalin, trans-perfluorodecalin, perfluorodecahydronaphthalene, naphthalene, octadecafluorodecahydro, f-dc, pp 5, perflunafenum latin |
| PubChem CID | 9386 |
| ChEBI | CHEBI:38848 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8,8a-octadecafluoronaphthalene |
| SMILES | C12(C(C(C(C(C1(F)F)(F)F)(F)F)(F)F)(C(C(C(C2(F)F)(F)F)(F)F)(F)F)F)F |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC130040250
|
Thermo Scientific Chemicals
130040250 |
25 g | Glass bottle |
Each for $116.00
|
|
||||
|
AC130041000
|
Thermo Scientific Chemicals
130041000 |
100 g | Glass bottle |
Each for $324.16
|
|
||||
|
AC130045000
|
Thermo Scientific Chemicals
130045000 |
500 g | Glass Bottle |
Each for $1,567.41
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 306-94-5 | |
| 462.08 | |
| UWEYRJFJVCLAGH-UHFFFAOYSA-N | |
| 9386 | |
| 1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8,8a-octadecafluoronaphthalene |
| C10F18 | |
| MFCD00010626 | |
| perfluorodecalin, perflunafene, octadecafluorodecahydronaphthalene, cis-perfluorodecalin, trans-perfluorodecalin, perfluorodecahydronaphthalene, naphthalene, octadecafluorodecahydro, f-dc, pp 5, perflunafenum latin | |
| CHEBI:38848 | |
| C12(C(C(C(C(C1(F)F)(F)F)(F)F)(F)F)(C(C(C(C2(F)F)(F)F)(F)F)(F)F)F)F |
Specifications
| 306-94-5 | |
| Colorless | |
| 142.0°C | |
| Authentic | |
| Glass bottle | |
| 1.3135 to 1.3155 | |
| 25 g | |
| 15,4215 | |
| Solubility in water: insoluble | |
| C12(C(C(C(C(C1(F)F)(F)F)(F)F)(F)F)(C(C(C(C2(F)F)(F)F)(F)F)(F)F)F)F | |
| 462.08 | |
| CHEBI:38848 | |
| 90% | |
| Perfluorodecalin |
| -10.0°C | |
| 1.9000g/mL | |
| 59°C | |
| 88% min. (GC) | |
| C10F18 | |
| MFCD00010626 | |
| 1.9 | |
| perfluorodecalin, perflunafene, octadecafluorodecahydronaphthalene, cis-perfluorodecalin, trans-perfluorodecalin, perfluorodecahydronaphthalene, naphthalene, octadecafluorodecahydro, f-dc, pp 5, perflunafenum latin | |
| UWEYRJFJVCLAGH-UHFFFAOYSA-N | |
| 1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8,8a-octadecafluoronaphthalene | |
| 9386 | |
| 462.08 | |
| Liquid |
Safety and Handling
GHS H Statement
Flammable liquid and vapor.
GHS P Statement
Keep away from heat/sparks/open flames/hot surfaces.
- No smoking.
Store in a well-ventilated place.
Keep container tightly closed.
GHS Signal Word: Warning
EINECSNumber : 206-192-4
RTECSNumber : QJ3175000
TSCA : TSCA
RUO – Research Use Only