Learn More
Perfluorobutyl iodide, 99%
CAS: 423-39-2 | C4F9I | 345.92 g/mol
Supplier: Thermo Scientific Chemicals 269951000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Perfluorobutyl iodide | |
| -88°C | |
| 2.0100g/mL | |
| >115°C | |
| 98.5% min. (GC) | |
| C4F9I | |
| CF3(CF2)3I | |
| 100 g | |
| perfluorobutyl iodide, nonafluoro-1-iodobutane, nonafluorobutyl iodide, perfluorobutyliodide, n-nonafluorobutyl iodide, perfluoro-n-butyl iodide, 1-iodoperfluorobutane, ccris 9008, 1-iodononafluorobutane, butane, 1,1,1,2,2,3,3,4,4-nonafluoro-4-iodo | |
| PGRFXXCKHGIFSV-UHFFFAOYSA-N | |
| 1,1,1,2,2,3,3,4,4-nonafluoro-4-iodobutane | |
| 67917 | |
| 99% |
| 423-39-2 | |
| Purple | |
| 64°C to 66°C (973.0 mbar) | |
| Authentic | |
| Glass bottle | |
| 1.3275 to 1.3295 | |
| MFCD00001062 | |
| 2.01 | |
| Solubility in water: immiscible | |
| C(C(C(F)(F)I)(F)F)(C(F)(F)F)(F)F | |
| 345.92 | |
| 345.92 | |
| Liquid |
Chemical Identifiers
| 423-39-2 | |
| 345.92 | |
| PGRFXXCKHGIFSV-UHFFFAOYSA-N | |
| 67917 | |
| C(C(C(F)(F)I)(F)F)(C(F)(F)F)(F)F |
| C4F9I | |
| MFCD00001062 | |
| perfluorobutyl iodide, nonafluoro-1-iodobutane, nonafluorobutyl iodide, perfluorobutyliodide, n-nonafluorobutyl iodide, perfluoro-n-butyl iodide, 1-iodoperfluorobutane, ccris 9008, 1-iodononafluorobutane, butane, 1,1,1,2,2,3,3,4,4-nonafluoro-4-iodo | |
| 1,1,1,2,2,3,3,4,4-nonafluoro-4-iodobutane |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
If skin irritation occurs: Get medical advice/attention.
If eye irritation persists: Get medical advice/attention.
Avoid breathing dust/fume/
GHS Signal Word: Warning
EINECSNumber : 207-025-8
RUO – Research Use Only