Learn More
Pentafluorobenzonitrile, 99%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 188340250
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| Pentafluorobenzonitrile | |
| 1.5300g/mL | |
| 29°C | |
| 98.5% min. (GC) | |
| 1.4415 to 1.4435 | |
| 25g | |
| pentafluorobenzonitrile, perfluorobenzonitrile, benzonitrile, pentafluoro, pentafluorocyanobenzene, benzonitrile, 2,3,4,5,6-pentafluoro, 2,3,4,5,6-pentafluoro benzonitrile, 2,3,4,5,6-pentafluorobenzenecarbonitrile, cyanopentafluorobenzene, pubchem2319, acmc-209p9k | |
| YXWJGZQOGXGSSC-UHFFFAOYSA-N | |
| 2,3,4,5,6-pentafluorobenzonitrile | |
| 69882 | |
| 99% |
| 773-82-0 | |
| 161.0°C to 162.0°C | |
| Authentic | |
| C7F5N | |
| C6F5CN | |
| 1.53 | |
| Solubility in water: insoluble. | |
| C(#N)C1=C(C(=C(C(=C1F)F)F)F)F | |
| 193.07 | |
| 193.07 |
Chemical Identifiers
| 773-82-0 | |
| 193.07 | |
| pentafluorobenzonitrile, perfluorobenzonitrile, benzonitrile, pentafluoro, pentafluorocyanobenzene, benzonitrile, 2,3,4,5,6-pentafluoro, 2,3,4,5,6-pentafluoro benzonitrile, 2,3,4,5,6-pentafluorobenzenecarbonitrile, cyanopentafluorobenzene, pubchem2319, acmc-209p9k | |
| 2,3,4,5,6-pentafluorobenzonitrile |
| C7F5N | |
| YXWJGZQOGXGSSC-UHFFFAOYSA-N | |
| 69882 | |
| C(#N)C1=C(C(=C(C(=C1F)F)F)F)F |
Safety and Handling
GHS H Statement
Flammable liquid and vapor.
Harmful if swallowed.
Harmful in contact with skin.
Harmful if inhaled.
GHS P Statement
Keep away from heat/sparks/open flames/hot surfaces.
- No smoking.
IF ON SKIN: Wash with plenty of soap and water.
GHS Signal Word: Danger
EINECSNumber : 212-259-9
RUO â Research Use Only