missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Papaverine hydrochloride, 99%
CAS: 61-25-6 | C20H21NO4·ClH | 375.85 g/mol
$215.06 - $215.06
Chemical Identifiers
| CAS | 61-25-6 |
|---|---|
| Molecular Formula | C20H21NO4·ClH |
| Molecular Weight (g/mol) | 375.85 |
| MDL Number | MFCD00012745 |
| InChI Key | UOTMYNBWXDUBNX-UHFFFAOYSA-N |
| Synonym | papaverine hydrochloride, cardiospan, cardoverina, dispamil, drapavel, forpavin, papalease, papaversan, pavatest, paverolan |
| PubChem CID | 6084 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinoline;hydrochloride |
| SMILES | COC1=C(C=C(C=C1)CC2=NC=CC3=CC(=C(C=C32)OC)OC)OC.Cl |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC207220250
|
Thermo Scientific Chemicals
207220250 |
25 g | Glass bottle |
Each for $215.06
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 61-25-6 | |
| 375.85 | |
| UOTMYNBWXDUBNX-UHFFFAOYSA-N | |
| 6084 | |
| COC1=C(C=C(C=C1)CC2=NC=CC3=CC(=C(C=C32)OC)OC)OC.Cl |
| C20H21NO4·ClH | |
| MFCD00012745 | |
| papaverine hydrochloride, cardiospan, cardoverina, dispamil, drapavel, forpavin, papalease, papaversan, pavatest, paverolan | |
| 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinoline;hydrochloride |
Specifications
| 61-25-6 | |
| White to Beige | |
| 99% | |
| C20H21NO4·ClH | |
| 25 g | |
| 15, 7122 | |
| Solubility in water: freely soluble. Other solubilities: soluble in alcohol and chloroform,practically insoluble in ether | |
| COC1=C(C=C(C=C1)CC2=NC=CC3=CC(=C(C=C32)OC)OC)OC.Cl | |
| 375.85 | |
| 375.85 | |
| Fine Crystalline Powder |
| 226.0°C | |
| Authentic | |
| Glass bottle | |
| MFCD00012745 | |
| 21, 222 | |
| papaverine hydrochloride, cardiospan, cardoverina, dispamil, drapavel, forpavin, papalease, papaversan, pavatest, paverolan | |
| UOTMYNBWXDUBNX-UHFFFAOYSA-N | |
| 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinoline;hydrochloride | |
| 6084 | |
| 99% | |
| Papaverine hydrochloride |
Safety and Handling
GHS H Statement
Toxic if swallowed.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
GHS Signal Word: Danger
EINECSNumber : 200-502-1
RUO – Research Use Only