Learn More
Pamoic acid, 98+%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 129725000
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| Pamoic acid | |
| 98+% | |
| MFCD00004079 | |
| 15, 7106 | |
| WLJNZVDCPSBLRP-UHFFFAOYSA-N | |
| 4-[(3-carboxy-2-hydroxynaphthalen-1-yl)methyl]-3-hydroxynaphthalene-2-carboxylic acid | |
| 8546 | |
| 388.38 | |
| 500g | |
| 1% max. (105°C, 1 hr) |
| 130-85-8 | |
| C23H16O6 | |
| 10, 575 | |
| pamoic acid, embonic acid, 4,4'-methylenebis 3-hydroxy-2-naphthoic acid, pamosaeure, unii-7rrq8qz38n, 2-naphthalenecarboxylic acid, 4,4'-methylenebis 3-hydroxy, 7rrq8qz38n, pamoic acid 98+% hplc, 4,4'-methylen-bis-3-hydroxy-2-naphthoesaeure | |
| OC(=O)C1=C(O)C(CC2=C3C=CC=CC3=CC(C(O)=O)=C2O)=C2C=CC=CC2=C1 | |
| 388.38 | |
| CHEBI:50186 | |
| ≥98% | |
| Authentic | |
| Plastic bottle |
Chemical Identifiers
| 130-85-8 | |
| 388.38 | |
| WLJNZVDCPSBLRP-UHFFFAOYSA-N | |
| 8546 | |
| 4-[(3-carboxy-2-hydroxynaphthalen-1-yl)methyl]-3-hydroxynaphthalene-2-carboxylic acid |
| C23H16O6 | |
| MFCD00004079 | |
| pamoic acid, embonic acid, 4,4'-methylenebis 3-hydroxy-2-naphthoic acid, pamosaeure, unii-7rrq8qz38n, 2-naphthalenecarboxylic acid, 4,4'-methylenebis 3-hydroxy, 7rrq8qz38n, pamoic acid 98+% hplc, 4,4'-methylen-bis-3-hydroxy-2-naphthoesaeure | |
| CHEBI:50186 | |
| OC(=O)C1=C(O)C(CC2=C3C=CC=CC3=CC(C(O)=O)=C2O)=C2C=CC=CC2=C1 |
Safety and Handling
GHS P Statement
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.
Warning
RUO â Research Use Only