missing translation for 'onlineSavingsMsg'
Learn More
Learn More
p-Toluenesulfonic acid, sodium salt, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 421231000
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| p-Toluenesulfonic acid, sodium salt | |
| >500°C | |
| Glass bottle | |
| MFCD00798566,MFCD00064388 | |
| 11,97 | |
| 14,9533 | |
| Solubility in water: soluble. | |
| [Na+].CC1=CC=C(C=C1)S([O-])(=O)=O | |
| 194.18 | |
| 194.19 |
| 657-84-1 | |
| Authentic | |
| C7H7NaO3S | |
| 100g | |
| 11,535; 12,507 | |
| sodium p-toluenesulfonate, sodium 4-methylbenzenesulfonate, sodium tosylate, p-toluenesulfonic acid sodium salt, sodium toluenesulfonate, sodium toluenesulphonate, tosylate, sodium, naxonate hydrotrope, cyclophil sts 70, eltesol st 34 | |
| KVCGISUBCHHTDD-UHFFFAOYSA-M | |
| sodium;4-methylbenzenesulfonate | |
| 3720192 | |
| ≥97.5% (ion exchange; alkalimetry) |
Chemical Identifiers
| 657-84-1 | |
| 194.18 | |
| KVCGISUBCHHTDD-UHFFFAOYSA-M | |
| 3720192 | |
| [Na+].CC1=CC=C(C=C1)S([O-])(=O)=O |
| C7H7NaO3S | |
| MFCD00798566,MFCD00064388 | |
| sodium p-toluenesulfonate, sodium 4-methylbenzenesulfonate, sodium tosylate, p-toluenesulfonic acid sodium salt, sodium toluenesulfonate, sodium toluenesulphonate, tosylate, sodium, naxonate hydrotrope, cyclophil sts 70, eltesol st 34 | |
| sodium;4-methylbenzenesulfonate |
Safety and Handling
GHS H Statement
Causes serious eye irritation.
GHS P Statement
Wear eye protection/face protection.
Wash face,hands and any exposed skin thoroughly after handling.
If eye irritation persists: Get medical advice/attention.
GHS Signal Word: Warning
EINECSNumber : 211-522-5
RUO â Research Use Only