missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Oxonic acid, potassium salt, 97.5%
CAS: 2207-75-2 | C4H2KN3O4 | 195.18 g/mol
Supplier: Thermo Scientific Chemicals 168531000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Oxonic acid, potassium salt | |
| 2207-75-2 | |
| White | |
| 97.5% | |
| C4H2KN3O4 | |
| 100 g | |
| potassium oxonate, oteracil potassium, oxonic acid potassium salt, allantoxanic acid potassium salt, potassium azaorotate, oxonic acid, potassium salt, oxonate, potassium, oxonate, allantoxanic acid | |
| [K+].[O-]C(=O)C1=NC(=O)NC(=O)N1 | |
| 195.18 | |
| CHEBI:80230 | |
| 97.5% |
| 97.5% | |
| >300.0°C | |
| Authentic | |
| Glass bottle | |
| MFCD00010565 | |
| 24, 451 | |
| IAPCTXZQXAVYNG-UHFFFAOYSA-M | |
| potassium;4,6-dioxo-1H-1,3,5-triazine-2-carboxylate | |
| 2723920 | |
| 195.18 | |
| Crystalline Powder |
Chemical Identifiers
| 2207-75-2 | |
| 195.18 | |
| IAPCTXZQXAVYNG-UHFFFAOYSA-M | |
| 2723920 | |
| potassium;4,6-dioxo-1H-1,3,5-triazine-2-carboxylate |
| C4H2KN3O4 | |
| MFCD00010565 | |
| potassium oxonate, oteracil potassium, oxonic acid potassium salt, allantoxanic acid potassium salt, potassium azaorotate, oxonic acid, potassium salt, oxonate, potassium, oxonate, allantoxanic acid | |
| CHEBI:80230 | |
| [K+].[O-]C(=O)C1=NC(=O)NC(=O)N1 |
Safety and Handling
EINECSNumber : 218-627-5
RTECSNumber : RR4580000
RUO – Research Use Only