missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Octocrylene, 95%, Spectrum™ Chemical
O3001, 6197-30-4, C24H27NO2
Supplier: Spectrum Chemical Mfg Cor O300150ML
Description
Spectrum™ Chemical Octocrylene is an organic compound known to be a viscous oily liquid. It is used as an ingredient in some cosmetics and sunscreens. Ungraded products supplied by Spectrum are indicative of a grade suitable for general industrial use or research purposes and typically are not suitable for human consumption or therapeutic use. These materials may or may not have a Certificate of Analysis available.Specifications
| 6197-30-4 | |
| 218°C | |
| C24H27NO2 | |
| 50 mL | |
| CCCCC(CC)COC(=O)C(C#N)=C(C1=CC=CC=C1)C1=CC=CC=C1 | |
| 361.49 | |
| Reagent |
| 1 | |
| Amber Glass Bottle | |
| MFCD00059260 | |
| FMJSMJQBSVNSBF-UHFFFAOYNA-N | |
| 2-ethylhexyl 2-cyano-3,3-diphenylprop-2-enoate | |
| 95% | |
| Liquid |
Chemical Identifiers
| 6197-30-4 | |
| 361.49 | |
| FMJSMJQBSVNSBF-UHFFFAOYNA-N | |
| CCCCC(CC)COC(=O)C(C#N)=C(C1=CC=CC=C1)C1=CC=CC=C1 |
| C24H27NO2 | |
| MFCD00059260 | |
| 2-ethylhexyl 2-cyano-3,3-diphenylprop-2-enoate |