Learn More
o-Tolidine dihydrochloride, 99%
CAS: 612-82-8 | C14H16N2·2HCl | 285.2 g/mol
$69.56 - $640.50
Chemical Identifiers
| CAS | 612-82-8 |
|---|---|
| Molecular Formula | C14H16N2·2HCl |
| Molecular Weight (g/mol) | 285.2 |
| InChI Key | LUKPNZHXJRJBAN-UHFFFAOYSA-N |
| Synonym | 3,3'-dimethylbenzidine dihydrochloride, o-tolidine dihydrochloride, 3,3'-dimethyl-1,1'-biphenyl-4,4'-diamine dihydrochloride, unii-5msk350kd8, dsstox_cid_511, dsstox_rid_75633, dsstox_gsid_20511, tolidine dihydrochloride, 1,1'-biphenyl-4,4'-diamine, 3,3'-dimethyl-, dihydrochloride, 3,3'-dimethylbenzidine.2hcl |
| PubChem CID | 108938 |
| IUPAC Name | 4-(4-amino-3-methylphenyl)-2-methylaniline;dihydrochloride |
| SMILES | CC1=C(C=CC(=C1)C2=CC(=C(C=C2)N)C)N.Cl.Cl |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC421130250
|
Thermo Scientific Chemicals
421130250 |
25 g | Glass Bottle |
Each for $69.56
|
|
||||
|
AC421131000
|
Thermo Scientific Chemicals
421131000 |
100 g | Glass Bottle |
Each for $207.26
|
|
||||
|
AC421135000
|
Thermo Scientific Chemicals
421135000 |
500 g | Glass Bottle |
Each for $640.50
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 612-82-8 | |
| 285.2 | |
| 3,3'-dimethylbenzidine dihydrochloride, o-tolidine dihydrochloride, 3,3'-dimethyl-1,1'-biphenyl-4,4'-diamine dihydrochloride, unii-5msk350kd8, dsstox_cid_511, dsstox_rid_75633, dsstox_gsid_20511, tolidine dihydrochloride, 1,1'-biphenyl-4,4'-diamine, 3,3'-dimethyl-, dihydrochloride, 3,3'-dimethylbenzidine.2hcl | |
| 4-(4-amino-3-methylphenyl)-2-methylaniline;dihydrochloride |
| C14H16N2·2HCl | |
| LUKPNZHXJRJBAN-UHFFFAOYSA-N | |
| 108938 | |
| CC1=C(C=CC(=C1)C2=CC(=C(C=C2)N)C)N.Cl.Cl |
Specifications
| 612-82-8 | |
| Beige to Beige-Gray | |
| 98.5% min. (on dry substance) (Argentometry) | |
| C14H16N2·2HCl | |
| 15,9675 | |
| LUKPNZHXJRJBAN-UHFFFAOYSA-N | |
| 4-(4-amino-3-methylphenyl)-2-methylaniline;dihydrochloride | |
| 108938 | |
| 99% | |
| o-Tolidine dihydrochloride |
| 130.0°C | |
| Authentic | |
| Glass Bottle | |
| 25 g | |
| 3,3'-dimethylbenzidine dihydrochloride, o-tolidine dihydrochloride, 3,3'-dimethyl-1,1'-biphenyl-4,4'-diamine dihydrochloride, unii-5msk350kd8, dsstox_cid_511, dsstox_rid_75633, dsstox_gsid_20511, tolidine dihydrochloride, 1,1'-biphenyl-4,4'-diamine, 3,3'-dimethyl-, dihydrochloride, 3,3'-dimethylbenzidine.2hcl | |
| CC1=C(C=CC(=C1)C2=CC(=C(C=C2)N)C)N.Cl.Cl | |
| 285.2 | |
| 285.2 | |
| Crystalline Powder |
Safety and Handling
GHS H Statement
May cause cancer.
Harmful if swallowed.
Toxic to aquatic life with long lasting effects.
GHS P Statement
Obtain special instructions before use.
IF exposed or concerned: Get medical advice/attention.
Avoid release to the environment.
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
GHS Signal Word: Danger
EINECSNumber : 210-322-5
RUO – Research Use Only