Learn More
O-Benzylhydroxylamine, 97%
CAS: 622-33-3 | C7H9NO | 123.15 g/mol
Supplier: Thermo Scientific Chemicals 382050050
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| O-Benzylhydroxylamine | |
| 96.0 | |
| Colorless | |
| 110°C to 112°C (20.0 mmHg) | |
| 96% min. (GC) | |
| C7H10ClNO | |
| C6H5CH2ONH2 | |
| 5 g | |
| 1.19 | |
| Solubility in water: soluble | |
| [H+].[Cl-].NOCC1=CC=CC=C1 | |
| 159.61 | |
| 123.15 | |
| Liquid |
| 622-33-3 | |
| 100.0 | |
| 1.1900g/mL | |
| Authentic | |
| Glass bottle | |
| 1.5390 to 1.5410 (20°C, 589nm) | |
| MFCD00221709 | |
| 06, IV, 2562 | |
| benzyloxyamine, hydroxylamine, o-phenylmethyl, hydroxylamine, o-benzyl, o-benzyl-hydroxylamine, benzyl-o-hydroxylamine, oxybenzylamine, o-phenylmethyl hydroxylamine, o-benzyloxylamine, phenylmethoxyamine, benzyloxy amine | |
| HYDZPXNVHXJHBG-UHFFFAOYSA-N | |
| hydrogen O-benzylhydroxylamine chloride | |
| 102313 | |
| 97% |
Chemical Identifiers
| 622-33-3 | |
| 159.61 | |
| HYDZPXNVHXJHBG-UHFFFAOYSA-N | |
| 102313 | |
| [H+].[Cl-].NOCC1=CC=CC=C1 |
| C7H10ClNO | |
| MFCD00221709 | |
| benzyloxyamine, hydroxylamine, o-phenylmethyl, hydroxylamine, o-benzyl, o-benzyl-hydroxylamine, benzyl-o-hydroxylamine, oxybenzylamine, o-phenylmethyl hydroxylamine, o-benzyloxylamine, phenylmethoxyamine, benzyloxy amine | |
| hydrogen O-benzylhydroxylamine chloride |
Safety and Handling
GHS H Statement
Causes serious eye irritation.
Causes skin irritation.
May cause respiratory irritation.
GHS P Statement
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present a
GHS Signal Word: Warning
RUO – Research Use Only