missing translation for 'onlineSavingsMsg'
Learn More
Learn More
O-Benzylhydroxylamine, 97%
CAS: 622-33-3 | C7H9NO | 123.15 g/mol
$131.32 - $546.18
Chemical Identifiers
| CAS | 622-33-3 |
|---|---|
| Molecular Formula | C7H10ClNO |
| Molecular Weight (g/mol) | 159.61 |
| MDL Number | MFCD00221709 |
| InChI Key | HYDZPXNVHXJHBG-UHFFFAOYSA-N |
| Synonym | benzyloxyamine, hydroxylamine, o-phenylmethyl, hydroxylamine, o-benzyl, o-benzyl-hydroxylamine, benzyl-o-hydroxylamine, oxybenzylamine, o-phenylmethyl hydroxylamine, o-benzyloxylamine, phenylmethoxyamine, benzyloxy amine |
| PubChem CID | 102313 |
| IUPAC Name | hydrogen O-benzylhydroxylamine chloride |
| SMILES | [H+].[Cl-].NOCC1=CC=CC=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC382050050
|
Thermo Scientific Chemicals
382050050 |
5 g | Glass bottle |
Each for $131.32
|
|
||||
|
AC382050250
|
Thermo Scientific Chemicals
382050250 |
25 g | Glass bottle |
Each for $546.18
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 622-33-3 | |
| 159.61 | |
| HYDZPXNVHXJHBG-UHFFFAOYSA-N | |
| 102313 | |
| [H+].[Cl-].NOCC1=CC=CC=C1 |
| C7H10ClNO | |
| MFCD00221709 | |
| benzyloxyamine, hydroxylamine, o-phenylmethyl, hydroxylamine, o-benzyl, o-benzyl-hydroxylamine, benzyl-o-hydroxylamine, oxybenzylamine, o-phenylmethyl hydroxylamine, o-benzyloxylamine, phenylmethoxyamine, benzyloxy amine | |
| hydrogen O-benzylhydroxylamine chloride |
Specifications
| 622-33-3 | |
| 100.0 | |
| 1.1900g/mL | |
| Authentic | |
| Glass bottle | |
| 1.5390 to 1.5410 (20°C, 589nm) | |
| MFCD00221709 | |
| 06, IV, 2562 | |
| benzyloxyamine, hydroxylamine, o-phenylmethyl, hydroxylamine, o-benzyl, o-benzyl-hydroxylamine, benzyl-o-hydroxylamine, oxybenzylamine, o-phenylmethyl hydroxylamine, o-benzyloxylamine, phenylmethoxyamine, benzyloxy amine | |
| HYDZPXNVHXJHBG-UHFFFAOYSA-N | |
| hydrogen O-benzylhydroxylamine chloride | |
| 102313 | |
| 97% | |
| O-Benzylhydroxylamine |
| 96.0 | |
| Colorless | |
| 110°C to 112°C (20.0 mmHg) | |
| 96% min. (GC) | |
| C7H10ClNO | |
| C6H5CH2ONH2 | |
| 5 g | |
| 1.19 | |
| Solubility in water: soluble | |
| [H+].[Cl-].NOCC1=CC=CC=C1 | |
| 159.61 | |
| 123.15 | |
| Liquid |
Safety and Handling
GHS H Statement
Causes serious eye irritation.
Causes skin irritation.
May cause respiratory irritation.
GHS P Statement
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present a
GHS Signal Word: Warning
RUO – Research Use Only