missing translation for 'onlineSavingsMsg'
Learn More
Learn More
O-Benzyl-L-serine, 99%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 440930050
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| O-Benzyl-L-serine | |
| 98.5 | |
| Authentic | |
| Glass bottle | |
| 5g | |
| o-benzyl-l-serine, h-ser bzl-oh, s-2-amino-3-benzyloxy propanoic acid, l-serine, o-phenylmethyl, 2s-2-amino-3-benzyloxy propanoic acid, o-phenylmethyl-l-serine, serine, o-phenylmethyl, benzylserine, o-benzylserine #, z-o-benzyl-l-serine | |
| C1=CC=C(C=C1)COCC(C(=O)O)N | |
| 195.22 | |
| 195.22 |
| 4726-96-9 | |
| 100.0 | |
| 98.5% min. (HPLC) | |
| C10H13NO3 | |
| 22.5 | |
| IDGQXGPQOGUGIX-VIFPVBQESA-N | |
| (2S)-2-amino-3-phenylmethoxypropanoic acid | |
| 78457 | |
| 99% |
Chemical Identifiers
| 4726-96-9 | |
| 195.22 | |
| o-benzyl-l-serine, h-ser bzl-oh, s-2-amino-3-benzyloxy propanoic acid, l-serine, o-phenylmethyl, 2s-2-amino-3-benzyloxy propanoic acid, o-phenylmethyl-l-serine, serine, o-phenylmethyl, benzylserine, o-benzylserine #, z-o-benzyl-l-serine | |
| (2S)-2-amino-3-phenylmethoxypropanoic acid |
| C10H13NO3 | |
| IDGQXGPQOGUGIX-VIFPVBQESA-N | |
| 78457 | |
| C1=CC=C(C=C1)COCC(C(=O)O)N |
Safety and Handling
EINECSNumber : 225-220-6
RUO â Research Use Only