missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Novobiocin Sodium Salt, MP Biomedicals™
Inhibits DNA synthesis by inhibiting the enzyme Topoisomerase II. Novobiocin Sodium Salt, MP Biomedicals is an antibiotic produced by Streptomyces nieveus. It is active against gram-positive bacteria. It is also a Hsp90 inhibitor 3.
$352.19 - $1,615.03
Chemical Identifiers
| CAS | 1476-53-5 |
|---|---|
| Molecular Formula | C31H35N2NaO11 |
| Molecular Weight (g/mol) | 634.61 |
| MDL Number | MFCD00066541,MFCD00066541 |
| InChI Key | AXOUUAINTJNFRS-UHFFFAOYNA-N |
| Synonym | Albamycin, Cathomycin sodium |
| PubChem CID | 131673945 |
| SMILES | [Na+].COC1C(OC(N)=O)C(O)C(OC2=CC=C3C(=O)[C-](NC(=O)C4=CC=C(O)C(CC=C(C)C)=C4)C(=O)OC3=C2C)OC1(C)C |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
ICN15595705
|
MP Biomedicals Inc
0215595705 |
5 g |
N/A
|
|
|||||
|
ICN15595725
|
MP Biomedicals Inc
0215595725 |
25 g |
N/A
|
|
|||||
Description
Inhibits DNA synthesis by inhibiting the enzyme Topoisomerase II. Novobiocin Sodium Salt, MP Biomedicals is an antibiotic produced by Streptomyces nieveus. It is active against gram-positive bacteria. It is also a Hsp90 inhibitor 3.
Novobiocin inhibits DNA synthesis by inhibiting bacterial DNA gyrase targeting the GyrB subunit of the enzyme involved in energy transduction. It acts as a competitive inhibitor of the ATPase reaction catalysed by GyrB 2. Uses include:
- For the production of positively supercoiled plasmid DNA
- Inhibitor of bacterial DNA gyrase and eukaryotic DNA topoisomerase
- Inhibitor of retrovirus RNA-dependent DNA-polymerase
- To study heat shock protein inhibition
Chemical Identifiers
| 1476-53-5 | |
| 634.61 | |
| AXOUUAINTJNFRS-UHFFFAOYNA-N | |
| 131673945 |
| C31H35N2NaO11 | |
| MFCD00066541,MFCD00066541 | |
| Albamycin, Cathomycin sodium | |
| [Na+].COC1C(OC(N)=O)C(O)C(OC2=CC=C3C(=O)[C-](NC(=O)C4=CC=C(O)C(CC=C(C)C)=C4)C(=O)OC3=C2C)OC1(C)C |
Specifications
| Powder | |
| λ max: 307nm | |
| E1%= 600 (0.1M NAOH) | |
| 5 g | |
| C31H35N2NaO11 | |
| Albamycin, Cathomycin sodium | |
| AXOUUAINTJNFRS-UHFFFAOYNA-N | |
| sodium 7-{[4-(carbamoyloxy)-3-hydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy}-3-[4-hydroxy-3-(3-methylbut-2-en-1-yl)benzamido]-8-methyl-2,4-dioxo-3,4-dihydro-2H-1-benzopyran-3-ide | |
| 131673945 |
| 1476-53-5 | |
| 220°C | |
| ∼900μg/mg | |
| −38.0° (2.5g/100ml ethanol at 24°C for the free acid) | |
| MFCD00066541,MFCD00066541 | |
| Freely soluble in water (10%, clear, colorless solution) | |
| [Na+].COC1C(OC(N)=O)C(O)C(OC2=CC=C3C(=O)[C-](NC(=O)C4=CC=C(O)C(CC=C(C)C)=C4)C(=O)OC3=C2C)OC1(C)C | |
| 634.61 | |
| 634.6 |
Safety and Handling
Recommended Storage : Store at 2–8°C.