Learn More
Nitrobenzene, 99%, Extra Pure
CAS: 98-95-3 | C6H5NO2 | 123.11 g/mol
Supplier: Thermo Scientific Chemicals 128420025
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Nitrobenzene | |
| 98.5 | |
| 5.0°C to 6.0°C | |
| 1.2050g/mL | |
| 88°C | |
| 98.5% min. (GC) | |
| C6H5NO2 | |
| C6H5NO2 | |
| 2.5 L | |
| 02,295; 07,251; 08,358; 17,16 | |
| 15, 6674 | |
| Solubility in water: slightly soluble. Other solubilities: soluble in alcohol,benzene,ether and oils | |
| C1=CC=C(C=C1)[N+](=O)[O-] | |
| 123.11 | |
| CHEBI:27798 | |
| 99% | |
| Liquid |
| 98-95-3 | |
| 100.0 | |
| Yellow | |
| 210.0°C to 211.0°C | |
| Authentic | |
| Glass bottle | |
| 1.5503 to 1.5523 | |
| MFCD00007043 | |
| 05, 233 | |
| 1.205 | |
| nitrobenzol, benzene, nitro, oil of mirbane, mirbane oil, essence of mirbane, nitro-benzene, nitrobenzeen, oil of myrbane, nitrobenzen, mononitrobenzene | |
| LQNUZADURLCDLV-UHFFFAOYSA-N | |
| nitrobenzene | |
| 7416 | |
| 123.11 | |
| Extra Pure |
Chemical Identifiers
| 98-95-3 | |
| 123.11 | |
| LQNUZADURLCDLV-UHFFFAOYSA-N | |
| 7416 | |
| nitrobenzene |
| C6H5NO2 | |
| MFCD00007043 | |
| nitrobenzol, benzene, nitro, oil of mirbane, mirbane oil, essence of mirbane, nitro-benzene, nitrobenzeen, oil of myrbane, nitrobenzen, mononitrobenzene | |
| CHEBI:27798 | |
| C1=CC=C(C=C1)[N+](=O)[O-] |
Safety and Handling
GHS H Statement
Toxic if inhaled.
Causes damage to organs through prolonged or repeated exposure.
Suspected of causing cancer.
Toxic in contact with skin.
Harmful to aquatic life with long lasting effects.
Toxic if sw
GHS P Statement
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN: Gently wash with plenty of soap and water.
IF INHALED: Remove
GHS Signal Word: Danger
EINECSNumber : 202-716-
RUO – Research Use Only