missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Nitrilotriacetic Acid, ACS Grade, ≥98%, MP Biomedicals™
Manufacturer: MP Biochemicals LLC 15255180
Specifications
| Nitrilotriacetic Acid | |
| 100g | |
| ≥98% | |
| 2,2',2-nitrilotriacetic acid | |
| C(C(=O)O)N(CC(=O)O)CC(=O)O | |
| 191.139 | |
| CHEBI:44557 | |
| Solid |
| White | |
| 139-13-9 | |
| C6H9NO6 | |
| MGFYIUFZLHCRTH-UHFFFAOYSA-N | |
| 2-[bis(carboxymethyl)amino]acetic acid | |
| 8758 | |
| 191.14 | |
| ACS Reagent |
Chemical Identifiers
| 139-13-9 | |
| 191.139 | |
| 2,2',2-nitrilotriacetic acid | |
| CHEBI:44557 | |
| C(C(=O)O)N(CC(=O)O)CC(=O)O |
| C6H9NO6 | |
| MGFYIUFZLHCRTH-UHFFFAOYSA-N | |
| 8758 | |
| 2-[bis(carboxymethyl)amino]acetic acid |
Safety and Handling
Recommended Storage : Store at room temperature (15° to 30°C)