Learn More
Nimodipine, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 329280010
| Quantity | 1g |
|---|
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 66085-59-4 | |
| 418.45 | |
| UIAGMCDKSXEBJQ-UHFFFAOYNA-N | |
| 4497 | |
| 3-O-(2-methoxyethyl) 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| C21H26N2O7 | |
| MFCD00153848 | |
| nimodipine, nimotop, periplum, nimodipino, nimodipinum, nymalize, admon, nimodipinum inn-latin, nimodipino inn-spanish, isopropyl 2-methoxyethyl 1,4-dihydro-2,6-dimethyl-4-m-nitrophenyl-3,5-pyridinedicarboxylate | |
| CHEBI:7575 | |
| COCCOC(=O)C1=C(C)NC(C)=C(C1C1=CC=CC(=C1)[N+]([O-])=O)C(=O)OC(C)C |
Specifications
| Nimodipine | |
| 0.5% max. (105°C, 4 h) | |
| C21H26N2O7 | |
| 1g | |
| nimodipine, nimotop, periplum, nimodipino, nimodipinum, nymalize, admon, nimodipinum inn-latin, nimodipino inn-spanish, isopropyl 2-methoxyethyl 1,4-dihydro-2,6-dimethyl-4-m-nitrophenyl-3,5-pyridinedicarboxylate | |
| UIAGMCDKSXEBJQ-UHFFFAOYNA-N | |
| 3-O-(2-methoxyethyl) 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate | |
| 4497 | |
| 418.44 |
| 66085-59-4 | |
| Authentic | |
| MFCD00153848 | |
| 15,6636 | |
| Solubility in water: insoluble. Other solubilities: soluble in dmso | |
| COCCOC(=O)C1=C(C)NC(C)=C(C1C1=CC=CC(=C1)[N+]([O-])=O)C(=O)OC(C)C | |
| 418.45 | |
| CHEBI:7575 | |
| ≥97.5% (HPLC) |
Safety and Handling
GHS H Statement
May cause damage to organs through prolonged or repeated exposure if swallowed.
GHS P Statement
Do not breathe dust/fume/gas/mist/vapors/spray.
Get medical attention/advice if you feel unwell.
GHS Signal Word: Warning
EINECSNumber : 266-127-