missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Nile Blue A, pure, certified
CAS: 3625-57-8 | C40H40N6O6S | 732.84 g/mol
$103.02 - $385.70
Chemical Identifiers
| CAS | 3625-57-8 |
|---|---|
| Molecular Formula | C40H40N6O6S |
| Molecular Weight (g/mol) | 732.84 |
| MDL Number | MFCD00064529 |
| InChI Key | QIRDPEPUXNCOLD-UHFFFAOYSA-N |
| Synonym | Nile blue sulfate, C.I. 51180 |
| PubChem CID | 19256 |
| IUPAC Name | [9-(diethylamino)benzo[a]phenoxazin-5-ylidene]azanium;sulfate |
| SMILES | CCN(CC)C1=CC2=C(C=C1)N=C3C4=CC=CC=C4C(=[NH2+])C=C3O2.CCN(CC)C1=CC2=C(C=C1)N=C3C4=CC=CC=C4C(=[NH2+])C=C3O2.[O-]S(=O)(=O)[O-] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC415690100
|
Thermo Scientific Chemicals
415690100 |
10 g | Glass bottle |
Each for $103.02
|
|
||||
|
AC415690500
|
Thermo Scientific Chemicals
415690500 |
50 g | Glass bottle |
Each for $385.70
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 3625-57-8 | |
| 732.84 | |
| QIRDPEPUXNCOLD-UHFFFAOYSA-N | |
| 19256 | |
| CCN(CC)C1=CC2=C(C=C1)N=C3C4=CC=CC=C4C(=[NH2+])C=C3O2.CCN(CC)C1=CC2=C(C=C1)N=C3C4=CC=CC=C4C(=[NH2+])C=C3O2.[O-]S(=O)(=O)[O-] |
| C40H40N6O6S | |
| MFCD00064529 | |
| Nile blue sulfate, C.I. 51180 | |
| [9-(diethylamino)benzo[a]phenoxazin-5-ylidene]azanium;sulfate |
Specifications
| 3625-57-8 | |
| 70% min. | |
| MFCD00064529 | |
| Nile blue sulfate, C.I. 51180 | |
| Authentic | |
| [9-(diethylamino)benzo[a]phenoxazin-5-ylidene]azanium;sulfate | |
| 19256 | |
| 732.87 | |
| Glass bottle | |
| 10 g | |
| Nile Blue A, Pure |
| 1.01 to 1.16 | |
| C40H40N6O6S | |
| 27, 404 | |
| QIRDPEPUXNCOLD-UHFFFAOYSA-N | |
| CCN(CC)C1=CC2=C(C=C1)N=C3C4=CC=CC=C4C(=[NH2+])C=C3O2.CCN(CC)C1=CC2=C(C=C1)N=C3C4=CC=CC=C4C(=[NH2+])C=C3O2.[O-]S(=O)(=O)[O-] | |
| 732.84 | |
| 635 to 646nm | |
| Pure | |
| Black to Green | |
| Powder |
RUO – Research Use Only