missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Nile Blue A, pure, certified
CAS: 3625-57-8 | C40H40N6O6S | 732.84 g/mol
Supplier: Thermo Scientific Chemicals 415690500
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Nile Blue A | |
| 3625-57-8 | |
| 70% min. | |
| MFCD00064529 | |
| Nile blue sulfate, C.I. 51180 | |
| Authentic | |
| [9-(diethylamino)benzo[a]phenoxazin-5-ylidene]azanium;sulfate | |
| 19256 | |
| 732.87 | |
| Glass bottle | |
| 50 g |
| Pure | |
| 1.01 to 1.16 | |
| C40H40N6O6S | |
| 27, 404 | |
| QIRDPEPUXNCOLD-UHFFFAOYSA-N | |
| CCN(CC)C1=CC2=C(C=C1)N=C3C4=CC=CC=C4C(=[NH2+])C=C3O2.CCN(CC)C1=CC2=C(C=C1)N=C3C4=CC=CC=C4C(=[NH2+])C=C3O2.[O-]S(=O)(=O)[O-] | |
| 732.84 | |
| 635 to 646nm | |
| Pure | |
| Black to Green | |
| Powder |
Chemical Identifiers
| 3625-57-8 | |
| 732.84 | |
| QIRDPEPUXNCOLD-UHFFFAOYSA-N | |
| 19256 | |
| CCN(CC)C1=CC2=C(C=C1)N=C3C4=CC=CC=C4C(=[NH2+])C=C3O2.CCN(CC)C1=CC2=C(C=C1)N=C3C4=CC=CC=C4C(=[NH2+])C=C3O2.[O-]S(=O)(=O)[O-] |
| C40H40N6O6S | |
| MFCD00064529 | |
| Nile blue sulfate, C.I. 51180 | |
| [9-(diethylamino)benzo[a]phenoxazin-5-ylidene]azanium;sulfate |
RUO – Research Use Only