Learn More
Nickel acetylacetonate, 96%
CAS: 3264-82-2 | C10H14NiO4 | 256.91 g/mol
$78.94 - $725.35
Chemical Identifiers
| CAS | 3264-82-2 |
|---|---|
| Molecular Formula | C10H14NiO4 |
| Molecular Weight (g/mol) | 256.91 |
| MDL Number | MFCD00000024 |
| InChI Key | BMGNSKKZFQMGDH-FDGPNNRMSA-L |
| Synonym | nickel ii acetylacetonate, bis 2,4-pentanedionato nickel ii hydrate, acetylacetone nickel ii salt, bis 2,4-pentanedionato nickel ii |
| PubChem CID | 53384569 |
| IUPAC Name | nickel(2+);(E)-4-oxopent-2-en-2-olate |
| SMILES | [Ni++].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC128260050
|
Thermo Scientific Chemicals
128260050 |
5 g | Glass bottle |
Each for $78.94
|
|
||||
|
AC128260250
|
Thermo Scientific Chemicals
128260250 |
25 g | Glass bottle |
Each for $244.81
|
|
||||
|
AC128261000
|
Thermo Scientific Chemicals
128261000 |
100 g | Glass bottle |
Each for $725.35
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 3264-82-2 | |
| 256.91 | |
| BMGNSKKZFQMGDH-FDGPNNRMSA-L | |
| 53384569 | |
| [Ni++].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O |
| C10H14NiO4 | |
| MFCD00000024 | |
| nickel ii acetylacetonate, bis 2,4-pentanedionato nickel ii hydrate, acetylacetone nickel ii salt, bis 2,4-pentanedionato nickel ii | |
| nickel(2+);(E)-4-oxopent-2-en-2-olate |
Specifications
| 3264-82-2 | |
| 100.0 | |
| Yellow | |
| Authentic | |
| Glass bottle | |
| MFCD00000024 | |
| 05,471; 06,417; 07,250; 08,42; 17,201 | |
| nickel ii acetylacetonate, bis 2,4-pentanedionato nickel ii hydrate, acetylacetone nickel ii salt, bis 2,4-pentanedionato nickel ii | |
| BMGNSKKZFQMGDH-FDGPNNRMSA-L | |
| nickel(2+);(E)-4-oxopent-2-en-2-olate | |
| 53384569 | |
| 96% | |
| Nickel acetylacetonate |
| 95.0 | |
| 230°C | |
| 220°C (11.0 mmHg) | |
| 95% min. (Complexometry) | |
| C10H14NiO4 | |
| 5 g | |
| 15, 6585 | |
| Solubility in water: soluble. Other solubilities: soluble in alcohol,chloroform and benzene,insoluble in ether and ligroin | |
| [Ni++].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O | |
| 256.91 | |
| 256.9 | |
| Liquid |
Safety and Handling
GHS H Statement
Harmful if swallowed.
May cause an allergic skin reaction.
May cause allergy or asthma symptoms or breathing difficulties if inhaled.
May cause cancer by inhalation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN: Wash with plenty of soap and water.
If experiencing respiratory symptoms: Call a POISON CENTER or doctor/physician.
IF INHALED: I
GHS Signal Word: Danger
EINECSNumber : 221-875-7
RUO – Research Use Only