Learn More
Thermo Scientific Chemicals Neutral Red, pure, certified
CAS: 553-24-2 | C15H17ClN4 | 288.779 g/mol
$222.63 - $760.23
Chemical Identifiers
| CAS | 553-24-2 |
|---|---|
| Molecular Formula | C15H17ClN4 |
| Molecular Weight (g/mol) | 288.779 |
| MDL Number | MFCD00012651 |
| InChI Key | PGSADBUBUOPOJS-UHFFFAOYSA-N |
| Synonym | Basic Red 5, C.I. 50040, 3-Amino-7-dimethylamino-2-methylphenazine hydrochloride |
| PubChem CID | 11105 |
| ChEBI | CHEBI:86370 |
| IUPAC Name | 8-N,8-N,3-trimethylphenazine-2,8-diamine;hydrochloride |
| SMILES | CC1=CC2=NC3=C(C=C(C=C3)N(C)C)N=C2C=C1N.Cl |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Qty | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Qty | ||||
|
AC415490250
|
Thermo Scientific Chemicals
415490250 |
25 g | Glass bottle |
Each for $222.63
|
|
||||
|
AC415491000
|
Thermo Scientific Chemicals
415491000 |
100 g | Glass bottle |
Each for $760.23
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
IndicatorChemical Identifiers
| 553-24-2 | |
| 288.779 | |
| PGSADBUBUOPOJS-UHFFFAOYSA-N | |
| 11105 | |
| 8-N,8-N,3-trimethylphenazine-2,8-diamine;hydrochloride |
| C15H17ClN4 | |
| MFCD00012651 | |
| Basic Red 5, C.I. 50040, 3-Amino-7-dimethylamino-2-methylphenazine hydrochloride | |
| CHEBI:86370 | |
| CC1=CC2=NC3=C(C=C(C=C3)N(C)C)N=C2C=C1N.Cl |
Specifications
| 290.0°C | |
| 1 to 1.12 | |
| C15H17ClN4 | |
| 25, 401 | |
| Basic Red 5, C.I. 50040, 3-Amino-7-dimethylamino-2-methylphenazine hydrochloride | |
| PGSADBUBUOPOJS-UHFFFAOYSA-N | |
| CC1=CC2=NC3=C(C=C(C=C3)N(C)C)N=C2C=C1N.Cl | |
| 288.779 | |
| CHEBI:86370 | |
| 288.77 | |
| Glass bottle | |
| 25 g | |
| Neutral Red, Pure |
| 553-24-2 | |
| 50% min. | |
| MFCD00012651 | |
| 15, 6573 | |
| Solubility in water: 50g/L. Other solubilities: 1.8% in abs. alcohol, 3.75% in cellosolve, 3.0% in ethylene glycol, practically insoluble in xylene | |
| Authentic | |
| 8-N,8-N,3-trimethylphenazine-2,8-diamine;hydrochloride | |
| 11105 | |
| 539 to 544nm | |
| Pure | |
| Green | |
| Crystalline Powder |
Safety and Handling
GHS H Statement:
Suspected of causing genetic defects.
GHS P Statement:
Use personal protective equipment as required.
WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge
RUO – Research Use Only