missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Nalpha-4-Tosyl-L-arginine methyl ester hydrochloride, 98+%
CAS: 1784-03-8 | C14H22N4O4S·HCl | 378.88 g/mol
Supplier: Thermo Scientific Chemicals 139200050
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Nα-4-Tosyl-L-arginine methyl ester hydrochloride | |
| 98.5 | |
| 146°C to 149°C | |
| Authentic | |
| Glass bottle | |
| H2NC(=NH)NH(CH2)3CH(NHSO2C6H4CH3)CO2CH3 | |
| 5 g | |
| tos-arg-ome.hcl, tame hydrochloride, tos-arg-ome hcl, nalpha-tosyl-l-arginine methyl ester hydrochloride, nalpha-p-tosyl-l-arginine methyl ester hydrochloride, nalpha-p-toluenesulfonyl-l-arginine methyl ester hydrochloride, tos-arg-omehcl, s-methyl 5-guanidino-2-4-methylphenylsulfonamido pentanoate hydrochloride, tosyl-l-arginine methyl ester hydrochloride, n-4-tosyl-l-arginine methyl ester hydrochloride | |
| CC1=CC=C(C=C1)S(=O)(=O)NC(CCCN=C(N)N)C(=O)OC.Cl | |
| 378.88 | |
| 378.88 | |
| Fine Crystalline Powder |
| 1784-03-8 | |
| 100.0 | |
| White | |
| 98+% | |
| C14H22N4O4S·HCl | |
| MFCD00012578 | |
| -14 | |
| JIQFFACVQXXHMY-YDALLXLXSA-N | |
| methyl (2S)-5-(diaminomethylideneamino)-2-[(4-methylphenyl)sulfonylamino]pentanoate;hydrochloride | |
| 2723792 | |
| 98+% |
Chemical Identifiers
| 1784-03-8 | |
| 378.88 | |
| JIQFFACVQXXHMY-YDALLXLXSA-N | |
| 2723792 | |
| CC1=CC=C(C=C1)S(=O)(=O)NC(CCCN=C(N)N)C(=O)OC.Cl |
| C14H22N4O4S·HCl | |
| MFCD00012578 | |
| tos-arg-ome.hcl, tame hydrochloride, tos-arg-ome hcl, nalpha-tosyl-l-arginine methyl ester hydrochloride, nalpha-p-tosyl-l-arginine methyl ester hydrochloride, nalpha-p-toluenesulfonyl-l-arginine methyl ester hydrochloride, tos-arg-omehcl, s-methyl 5-guanidino-2-4-methylphenylsulfonamido pentanoate hydrochloride, tosyl-l-arginine methyl ester hydrochloride, n-4-tosyl-l-arginine methyl ester hydrochloride | |
| methyl (2S)-5-(diaminomethylideneamino)-2-[(4-methylphenyl)sulfonylamino]pentanoate;hydrochloride |
Safety and Handling
EINECSNumber : 217-235-1
RUO – Research Use Only