missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Nalpha-4-Tosyl-L-arginine methyl ester hydrochloride, 98+%
CAS: 1784-03-8 | C14H22N4O4S·HCl | 378.88 g/mol
$85.83 - $158.69
Chemical Identifiers
| CAS | 1784-03-8 |
|---|---|
| Molecular Formula | C14H22N4O4S·HCl |
| Molecular Weight (g/mol) | 378.88 |
| MDL Number | MFCD00012578 |
| InChI Key | JIQFFACVQXXHMY-YDALLXLXSA-N |
| Synonym | tos-arg-ome.hcl, tame hydrochloride, tos-arg-ome hcl, nalpha-tosyl-l-arginine methyl ester hydrochloride, nalpha-p-tosyl-l-arginine methyl ester hydrochloride, nalpha-p-toluenesulfonyl-l-arginine methyl ester hydrochloride, tos-arg-omehcl, s-methyl 5-guanidino-2-4-methylphenylsulfonamido pentanoate hydrochloride, tosyl-l-arginine methyl ester hydrochloride, n-4-tosyl-l-arginine methyl ester hydrochloride |
| PubChem CID | 2723792 |
| IUPAC Name | methyl (2S)-5-(diaminomethylideneamino)-2-[(4-methylphenyl)sulfonylamino]pentanoate;hydrochloride |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC(CCCN=C(N)N)C(=O)OC.Cl |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC139200050
|
Thermo Scientific Chemicals
139200050 |
5 g | Glass bottle |
N/A
|
|
||||
|
AC139200100
|
Thermo Scientific Chemicals
139200100 |
10 g | Glass bottle |
N/A
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 1784-03-8 | |
| 378.88 | |
| JIQFFACVQXXHMY-YDALLXLXSA-N | |
| 2723792 | |
| CC1=CC=C(C=C1)S(=O)(=O)NC(CCCN=C(N)N)C(=O)OC.Cl |
| C14H22N4O4S·HCl | |
| MFCD00012578 | |
| tos-arg-ome.hcl, tame hydrochloride, tos-arg-ome hcl, nalpha-tosyl-l-arginine methyl ester hydrochloride, nalpha-p-tosyl-l-arginine methyl ester hydrochloride, nalpha-p-toluenesulfonyl-l-arginine methyl ester hydrochloride, tos-arg-omehcl, s-methyl 5-guanidino-2-4-methylphenylsulfonamido pentanoate hydrochloride, tosyl-l-arginine methyl ester hydrochloride, n-4-tosyl-l-arginine methyl ester hydrochloride | |
| methyl (2S)-5-(diaminomethylideneamino)-2-[(4-methylphenyl)sulfonylamino]pentanoate;hydrochloride |
Specifications
| 1784-03-8 | |
| 100.0 | |
| White | |
| 98+% | |
| C14H22N4O4S·HCl | |
| MFCD00012578 | |
| -14 | |
| JIQFFACVQXXHMY-YDALLXLXSA-N | |
| methyl (2S)-5-(diaminomethylideneamino)-2-[(4-methylphenyl)sulfonylamino]pentanoate;hydrochloride | |
| 2723792 | |
| 98+% | |
| Nα-4-Tosyl-L-arginine methyl ester hydrochloride |
| 98.5 | |
| 146°C to 149°C | |
| Authentic | |
| Glass bottle | |
| H2NC(=NH)NH(CH2)3CH(NHSO2C6H4CH3)CO2CH3 | |
| 5 g | |
| tos-arg-ome.hcl, tame hydrochloride, tos-arg-ome hcl, nalpha-tosyl-l-arginine methyl ester hydrochloride, nalpha-p-tosyl-l-arginine methyl ester hydrochloride, nalpha-p-toluenesulfonyl-l-arginine methyl ester hydrochloride, tos-arg-omehcl, s-methyl 5-guanidino-2-4-methylphenylsulfonamido pentanoate hydrochloride, tosyl-l-arginine methyl ester hydrochloride, n-4-tosyl-l-arginine methyl ester hydrochloride | |
| CC1=CC=C(C=C1)S(=O)(=O)NC(CCCN=C(N)N)C(=O)OC.Cl | |
| 378.88 | |
| 378.88 | |
| Fine Crystalline Powder |
Safety and Handling
EINECSNumber : 217-235-1
RUO – Research Use Only