missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Nalidixic Acid, Fisher BioReagents
Supplier: Fisher BioReagents FLBP90825
Description
- Nalidixic acid is an antibiotic that inhibits growth and reproduction primarily in gram-negative bacteria, with some effectiveness against gram-positive bacteria
- Blocks DNA replication in susceptible bacteria by interfering with DNA gyrase activity
- Can be used as a selective agent as some bacteria are resistant to nalixidic acid
- Intended for research use only
Specifications
| Nalidixic Acid | |
| 225°C | |
| 0.5% max. | |
| ≥98 % | |
| C12H12N2O3 | |
| 15, 6444 | |
| MHWLWQUZZRMNGJ-UHFFFAOYSA-N | |
| 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylic acid | |
| 4421 | |
| 232.24 | |
| Powder |
| 389-08-2 | |
| White | |
| 225°C to 231°C | |
| Poly Bottle | |
| 25 g | |
| nalidixic acid, nalidixin, nevigramon, nalidixate, uronidix, innoxalon, nalidixan, nalitucsan, sicmylon, unaserus | |
| CCN1C=C(C(=O)C2=C1N=C(C=C2)C)C(=O)O | |
| 232.239 | |
| CHEBI:100147 | |
| ≥98% |
Chemical Identifiers
| 389-08-2 | |
| 232.239 | |
| nalidixic acid, nalidixin, nevigramon, nalidixate, uronidix, innoxalon, nalidixan, nalitucsan, sicmylon, unaserus | |
| CHEBI:100147 | |
| CCN1C=C(C(=O)C2=C1N=C(C=C2)C)C(=O)O |
| C12H12N2O3 | |
| MHWLWQUZZRMNGJ-UHFFFAOYSA-N | |
| 4421 | |
| 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylic acid |
Safety and Handling
Recommended Storage : RT