missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Naftifine hydrochloride, 99%, Thermo Scientific Chemicals
$162.26 - $162.26
Chemical Identifiers
| CAS | 65473-14-5 |
|---|---|
| Molecular Formula | C21H21N·ClH |
| Molecular Weight (g/mol) | 323.86 |
| InChI Key | OLUNPKFOFGZHRT-YGCVIUNWSA-N |
| Synonym | naftifine hydrochloride, naftifine hcl, naftin, exoderil, naftifungin, n-trans-cinnamyl-n-methyl-1-naphthylmethyl amine hydrochloride, e-n-cinnamyl-n-methyl-1-naphthalenemethylamine hydrochloride, naftin tn, e-n-methyl-n-1-naphthylmethyl-3-phenyl-2-propen-1-amine-hydrochloride |
| PubChem CID | 5281098 |
| ChEBI | CHEBI:7452 |
| IUPAC Name | (E)-N-methyl-N-(naphthalen-1-ylmethyl)-3-phenylprop-2-en-1-amine;hydrochloride |
| SMILES | CN(CC=CC1=CC=CC=C1)CC2=CC=CC3=CC=CC=C32.Cl |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AC458660010
|
Thermo Scientific Chemicals
458660010 |
1 g |
Each for $162.26
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 65473-14-5 | |
| 323.86 | |
| naftifine hydrochloride, naftifine hcl, naftin, exoderil, naftifungin, n-trans-cinnamyl-n-methyl-1-naphthylmethyl amine hydrochloride, e-n-cinnamyl-n-methyl-1-naphthalenemethylamine hydrochloride, naftin tn, e-n-methyl-n-1-naphthylmethyl-3-phenyl-2-propen-1-amine-hydrochloride | |
| CHEBI:7452 | |
| CN(CC=CC1=CC=CC=C1)CC2=CC=CC3=CC=CC=C32.Cl |
| C21H21N·ClH | |
| OLUNPKFOFGZHRT-YGCVIUNWSA-N | |
| 5281098 | |
| (E)-N-methyl-N-(naphthalen-1-ylmethyl)-3-phenylprop-2-en-1-amine;hydrochloride |
Specifications
| 65473-14-5 | |
| Authentic | |
| Glass Bottle | |
| 1 g | |
| Solubility in water: 0.0068g/L ( 25°C ). Other solubilities: in ethanol 0.034g/L ( 25°C ) | |
| CN(CC=CC1=CC=CC=C1)CC2=CC=CC3=CC=CC=C32.Cl | |
| 323.86 | |
| CHEBI:7452 | |
| 99% |
| 175.0°C to 179.0°C | |
| 99% | |
| C21H21N·ClH | |
| naftifine hydrochloride, naftifine hcl, naftin, exoderil, naftifungin, n-trans-cinnamyl-n-methyl-1-naphthylmethyl amine hydrochloride, e-n-cinnamyl-n-methyl-1-naphthalenemethylamine hydrochloride, naftin tn, e-n-methyl-n-1-naphthylmethyl-3-phenyl-2-propen-1-amine-hydrochloride | |
| OLUNPKFOFGZHRT-YGCVIUNWSA-N | |
| (E)-N-methyl-N-(naphthalen-1-ylmethyl)-3-phenylprop-2-en-1-amine;hydrochloride | |
| 5281098 | |
| 323.86 | |
| Naftifine hydrochloride |
RUO – Research Use Only