missing translation for 'onlineSavingsMsg'
Learn More
Learn More
N,N-Dimethylanilinium Tetrakis(pentafluorophenyl)borate 98.0+%, TCI America™
Supplier: TCI America D4404200MG
Specifications
| N,N-Dimethylanilinium Tetrakis(pentafluorophenyl)borate | |
| 227°C | |
| C32H12BF20N | |
| 200 mg | |
| BRHZQNMGSKUUMN-UHFFFAOYSA-O | |
| dimethyl(phenyl)azanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide | |
| 10996402 | |
| ≥98.0% (T) |
| 118612-00-3 | |
| White | |
| MFCD01074420 | |
| dimethylanilinium tetrakis pentafluorophenyl borate, unii-h8r86l92nd, n,n-dimethylanilinium tetrakis pentafluorophenyl borate, n,n-dimethylbenzenaminium tetrakis perfluorophenyl borate, n,n-dimethylanilinium tetra pentafluorophenyl borate, benzene, pentafluoro-, boron complex, n,n-dimethylanilinium tetrakis pentafluorophenyl borate 1-, benzenamine, n,n-dimethyl-, tetrakis pentafluorophenyl borate 1-, dimethyl phenyl ammonium tetrakis 2,3,4,5,6-pentafluorophenyl borate, borate 1-, tetrakis pentafluorophenyl-, hydrogen, compd. with n,n-dimethylbenzenamine 1:1:1 | |
| [B-](C1=C(C(=C(C(=C1F)F)F)F)F)(C2=C(C(=C(C(=C2F)F)F)F)F)(C3=C(C(=C(C(=C3F)F)F)F)F)C4=C(C(=C(C(=C4F)F)F)F)F.C[NH+](C)C1=CC=CC=C1 | |
| 801.233 | |
| 801.23 | |
| Crystalline Powder |
Chemical Identifiers
| 118612-00-3 | |
| 801.233 | |
| BRHZQNMGSKUUMN-UHFFFAOYSA-O | |
| 10996402 | |
| [B-](C1=C(C(=C(C(=C1F)F)F)F)F)(C2=C(C(=C(C(=C2F)F)F)F)F)(C3=C(C(=C(C(=C3F)F)F)F)F)C4=C(C(=C(C(=C4F)F)F)F)F.C[NH+](C)C1=CC=CC=C1 |
| C32H12BF20N | |
| MFCD01074420 | |
| dimethylanilinium tetrakis pentafluorophenyl borate, unii-h8r86l92nd, n,n-dimethylanilinium tetrakis pentafluorophenyl borate, n,n-dimethylbenzenaminium tetrakis perfluorophenyl borate, n,n-dimethylanilinium tetra pentafluorophenyl borate, benzene, pentafluoro-, boron complex, n,n-dimethylanilinium tetrakis pentafluorophenyl borate 1-, benzenamine, n,n-dimethyl-, tetrakis pentafluorophenyl borate 1-, dimethyl phenyl ammonium tetrakis 2,3,4,5,6-pentafluorophenyl borate, borate 1-, tetrakis pentafluorophenyl-, hydrogen, compd. with n,n-dimethylbenzenamine 1:1:1 | |
| dimethyl(phenyl)azanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
Safety and Handling
EINECSNumber : (3)-4390
TSCA : No