Learn More
N-Methyl-N-(trimethylsilyl)trifluoroacetamide, 97%
CAS: 24589-78-4 | C6H12F3NOSi | 199.25 g/mol
Supplier: Thermo Scientific Chemicals 221580050
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Alkylation reagent, Silylation reagentSpecifications
| N-Methyl-N-(trimethylsilyl)trifluoroacetamide | |
| 96.0 | |
| Colorless to Yellow | |
| 130°C to 132°C | |
| Authentic | |
| Glass bottle | |
| 1.3782 to 1.3802 | |
| MFCD00000411 | |
| 1.07 | |
| Solubility in water: reacts | |
| CN(C(=O)C(F)(F)F)[Si](C)(C)C | |
| 199.25 | |
| CHEBI:85064 | |
| 97% |
| 24589-78-4 | |
| 100.0 | |
| 1.0700g/mL | |
| 25°C | |
| 96% min. (GC) | |
| C6H12F3NOSi | |
| CF3CON(CH3)Si(CH3)3 | |
| 5 g | |
| mstfa, n-methyl-n-trimethylsilyl trifluoroacetamide, 2,2,2-trifluoro-n-methyl-n-trimethylsilyl acetamide, n-methyl-n-trimethylsilyltrifluoroacetamide, acetamide, 2,2,2-trifluoro-n-methyl-n-trimethylsilyl, n-methyl-n-trimethylsilyl-trifluoroacetamide, acmc-209tfm | |
| MSPCIZMDDUQPGJ-UHFFFAOYSA-N | |
| 2,2,2-trifluoro-N-methyl-N-trimethylsilylacetamide | |
| 32510 | |
| 199.25 | |
| Liquid |
Chemical Identifiers
| 24589-78-4 | |
| 199.25 | |
| MSPCIZMDDUQPGJ-UHFFFAOYSA-N | |
| 32510 | |
| 2,2,2-trifluoro-N-methyl-N-trimethylsilylacetamide |
| C6H12F3NOSi | |
| MFCD00000411 | |
| mstfa, n-methyl-n-trimethylsilyl trifluoroacetamide, 2,2,2-trifluoro-n-methyl-n-trimethylsilyl acetamide, n-methyl-n-trimethylsilyltrifluoroacetamide, acetamide, 2,2,2-trifluoro-n-methyl-n-trimethylsilyl, n-methyl-n-trimethylsilyl-trifluoroacetamide, acmc-209tfm | |
| CHEBI:85064 | |
| CN(C(=O)C(F)(F)F)[Si](C)(C)C |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
Flammable liquid and vapor.
GHS P Statement
Avoid breathing dust/fume/gas/mist/vapors/spray.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present
GHS Signal Word: Warning
EINECSNumber : 246-331-6
RUO – Research Use Only