Learn More
N-Methyl-N-(trimethylsilyl)trifluoroacetamide, 97%
CAS: 24589-78-4 | C6H12F3NOSi | 199.25 g/mol
$131.90 - $1,328.35
Chemical Identifiers
| CAS | 24589-78-4 |
|---|---|
| Molecular Formula | C6H12F3NOSi |
| Molecular Weight (g/mol) | 199.25 |
| MDL Number | MFCD00000411 |
| InChI Key | MSPCIZMDDUQPGJ-UHFFFAOYSA-N |
| Synonym | mstfa, n-methyl-n-trimethylsilyl trifluoroacetamide, 2,2,2-trifluoro-n-methyl-n-trimethylsilyl acetamide, n-methyl-n-trimethylsilyltrifluoroacetamide, acetamide, 2,2,2-trifluoro-n-methyl-n-trimethylsilyl, n-methyl-n-trimethylsilyl-trifluoroacetamide, acmc-209tfm |
| PubChem CID | 32510 |
| ChEBI | CHEBI:85064 |
| IUPAC Name | 2,2,2-trifluoro-N-methyl-N-trimethylsilylacetamide |
| SMILES | CN(C(=O)C(F)(F)F)[Si](C)(C)C |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC221580050
|
Thermo Scientific Chemicals
221580050 |
5 g | Glass bottle |
N/A
|
|
||||
|
AC221580250
|
Thermo Scientific Chemicals
221580250 |
25 g | Glass Bottle |
N/A
|
|
||||
|
AC221581000
|
Thermo Scientific Chemicals
221581000 |
100 g | Glass bottle |
N/A
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Alkylation reagent, Silylation reagentChemical Identifiers
| 24589-78-4 | |
| 199.25 | |
| MSPCIZMDDUQPGJ-UHFFFAOYSA-N | |
| 32510 | |
| 2,2,2-trifluoro-N-methyl-N-trimethylsilylacetamide |
| C6H12F3NOSi | |
| MFCD00000411 | |
| mstfa, n-methyl-n-trimethylsilyl trifluoroacetamide, 2,2,2-trifluoro-n-methyl-n-trimethylsilyl acetamide, n-methyl-n-trimethylsilyltrifluoroacetamide, acetamide, 2,2,2-trifluoro-n-methyl-n-trimethylsilyl, n-methyl-n-trimethylsilyl-trifluoroacetamide, acmc-209tfm | |
| CHEBI:85064 | |
| CN(C(=O)C(F)(F)F)[Si](C)(C)C |
Specifications
| 24589-78-4 | |
| 100.0 | |
| 1.0700g/mL | |
| 25°C | |
| 96% min. (GC) | |
| C6H12F3NOSi | |
| CF3CON(CH3)Si(CH3)3 | |
| 5 g | |
| mstfa, n-methyl-n-trimethylsilyl trifluoroacetamide, 2,2,2-trifluoro-n-methyl-n-trimethylsilyl acetamide, n-methyl-n-trimethylsilyltrifluoroacetamide, acetamide, 2,2,2-trifluoro-n-methyl-n-trimethylsilyl, n-methyl-n-trimethylsilyl-trifluoroacetamide, acmc-209tfm | |
| MSPCIZMDDUQPGJ-UHFFFAOYSA-N | |
| 2,2,2-trifluoro-N-methyl-N-trimethylsilylacetamide | |
| 32510 | |
| 199.25 | |
| Liquid |
| 96.0 | |
| Colorless to Yellow | |
| 130°C to 132°C | |
| Authentic | |
| Glass bottle | |
| 1.3782 to 1.3802 | |
| MFCD00000411 | |
| 1.07 | |
| Solubility in water: reacts | |
| CN(C(=O)C(F)(F)F)[Si](C)(C)C | |
| 199.25 | |
| CHEBI:85064 | |
| 97% | |
| N-Methyl-N-(trimethylsilyl)trifluoroacetamide |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
Flammable liquid and vapor.
GHS P Statement
Avoid breathing dust/fume/gas/mist/vapors/spray.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present
GHS Signal Word: Warning
EINECSNumber : 246-331-6
RUO – Research Use Only