missing translation for 'onlineSavingsMsg'
Learn More
Learn More
N-(Diphenylmethylene)glycine tert-butyl ester, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 369320010
| Quantity | 1g |
|---|---|
| Packaging | Glass bottle |
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 81477-94-3 | |
| 295.38 | |
| YSHDPXQDVKNPKA-UHFFFAOYSA-N | |
| 688171 | |
| CC(C)(C)OC(=O)CN=C(C1=CC=CC=C1)C2=CC=CC=C2 |
| C19H21NO2 | |
| MFCD00134280 | |
| n-diphenylmethylene glycine tert-butyl ester, diphenylmethylene-glycine t-butyl ester, tert-butyl 2-diphenylmethylene amino acetate, n-diphenylmethylene glycerine tert-butyl ester, tert-butyl 2-diphenylmethyleneamino acetate, diphenylmethyleneamino acetic acid tert-butyl ester, tert-butyl diphenylmethyleneamino acetate, n-diphenylmethylene glycinetert-butylester, tert-butyl 2-benzhydrylideneamino acetate, glycine, n-diphenylmethylene-, 1,1-dimethylethyl ester | |
| tert-butyl 2-(benzhydrylideneamino)acetate |
Specifications
| N-(Diphenylmethylene)glycine tert-butyl ester | |
| 97.5% min. (HPLC) | |
| C19H21NO2 | |
| 1g | |
| n-diphenylmethylene glycine tert-butyl ester, diphenylmethylene-glycine t-butyl ester, tert-butyl 2-diphenylmethylene amino acetate, n-diphenylmethylene glycerine tert-butyl ester, tert-butyl 2-diphenylmethyleneamino acetate, diphenylmethyleneamino acetic acid tert-butyl ester, tert-butyl diphenylmethyleneamino acetate, n-diphenylmethylene glycinetert-butylester, tert-butyl 2-benzhydrylideneamino acetate, glycine, n-diphenylmethylene-, 1,1-dimethylethyl ester | |
| CC(C)(C)OC(=O)CN=C(C1=CC=CC=C1)C2=CC=CC=C2 | |
| 295.38 | |
| 295.38 |
| 81477-94-3 | |
| Glass bottle | |
| (C6H5)2C=NCH2CO2C(CH3)3 | |
| MFCD00134280 | |
| YSHDPXQDVKNPKA-UHFFFAOYSA-N | |
| tert-butyl 2-(benzhydrylideneamino)acetate | |
| 688171 | |
| 98% |