missing translation for 'onlineSavingsMsg'
Learn More
Learn More
N-BOC-O-Benzyl-D-serine, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 334670050
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| N-BOC-O-Benzyl-D-serine | |
| 47173-80-8 | |
| 100.0 | |
| 97.5% min. (HPLC) | |
| C15H20NO5 | |
| 5g | |
| -19 | |
| DMBKPDOAQVGTST-GFCCVEGCSA-M | |
| (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxypropanoic acid | |
| 2733693 | |
| 98% |
| 98% | |
| 97.5 | |
| Authentic | |
| Glass bottle | |
| MFCD00038248 | |
| −19.00 (20.00°C c=2 80% alcohol) | |
| n-boc-o-benzyl-d-serine, boc-d-ser bzl-oh, boc-o-benzyl-d-serine, o-benzyl-n-tert-butoxycarbonyl-d-serine, d-serine, n-1,1-dimethylethoxy carbonyl-o-phenylmethyl, 2r-3-benzyloxy-2-tert-butoxycarbonyl amino propanoic acid, 2r-3-benzyl-oxy-2-tert-butoxy carbonyl amino propanoic acid, pubchem12444, pubchem14944, boc-d-ser obn-oh | |
| CC(C)(C)OC(=O)N[C@H](COCC1=CC=CC=C1)C([O-])=O | |
| 294.33 | |
| 295.33 |
Chemical Identifiers
| 47173-80-8 | |
| 294.33 | |
| DMBKPDOAQVGTST-GFCCVEGCSA-M | |
| 2733693 | |
| CC(C)(C)OC(=O)N[C@H](COCC1=CC=CC=C1)C([O-])=O |
| C15H20NO5 | |
| MFCD00038248 | |
| n-boc-o-benzyl-d-serine, boc-d-ser bzl-oh, boc-o-benzyl-d-serine, o-benzyl-n-tert-butoxycarbonyl-d-serine, d-serine, n-1,1-dimethylethoxy carbonyl-o-phenylmethyl, 2r-3-benzyloxy-2-tert-butoxycarbonyl amino propanoic acid, 2r-3-benzyl-oxy-2-tert-butoxy carbonyl amino propanoic acid, pubchem12444, pubchem14944, boc-d-ser obn-oh | |
| (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxypropanoic acid |
RUO â Research Use Only