Learn More
N-Acetylsulfanilyl chloride, 99%
CAS: 121-60-8 | C8H8ClNO3S | 233.67 g/mol
$83.45 - $249.64
Chemical Identifiers
| CAS | 121-60-8 |
|---|---|
| Molecular Formula | C8H8ClNO3S |
| Molecular Weight (g/mol) | 233.67 |
| MDL Number | MFCD00007442 |
| InChI Key | GRDXCFKBQWDAJH-UHFFFAOYSA-N |
| Synonym | n-acetylsulfanilyl chloride, 4-acetamidobenzene-1-sulfonyl chloride, dagenan chloride, 4-acetylamino benzenesulfonyl chloride, 4-acetamidophenylsulfonyl chloride, benzenesulfonyl chloride, 4-acetylamino, acetylsulfanilyl chloride, p-acetamidobenzenesulfonyl chloride, n-acetylsulphanilyl chloride, p-acetaminobenzenesulfonyl chloride |
| PubChem CID | 8481 |
| IUPAC Name | 4-acetamidobenzenesulfonyl chloride |
| SMILES | CC(=O)NC1=CC=C(C=C1)S(Cl)(=O)=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC150721000
|
Thermo Scientific Chemicals
150721000 |
100 g | Glass bottle |
Each for $83.45
|
|
||||
|
AC150725000
|
Thermo Scientific Chemicals
150725000 |
500 g | Glass bottle |
Each for $249.64
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 121-60-8 | |
| 233.67 | |
| GRDXCFKBQWDAJH-UHFFFAOYSA-N | |
| 8481 | |
| CC(=O)NC1=CC=C(C=C1)S(Cl)(=O)=O |
| C8H8ClNO3S | |
| MFCD00007442 | |
| n-acetylsulfanilyl chloride, 4-acetamidobenzene-1-sulfonyl chloride, dagenan chloride, 4-acetylamino benzenesulfonyl chloride, 4-acetamidophenylsulfonyl chloride, benzenesulfonyl chloride, 4-acetylamino, acetylsulfanilyl chloride, p-acetamidobenzenesulfonyl chloride, n-acetylsulphanilyl chloride, p-acetaminobenzenesulfonyl chloride | |
| 4-acetamidobenzenesulfonyl chloride |
Specifications
| 121-60-8 | |
| 100.0 | |
| Beige-Cream to White | |
| Authentic | |
| Glass bottle | |
| 4-(CH3CONH)C6H4SO2Cl | |
| 100 g | |
| 01,3 | |
| n-acetylsulfanilyl chloride, 4-acetamidobenzene-1-sulfonyl chloride, dagenan chloride, 4-acetylamino benzenesulfonyl chloride, 4-acetamidophenylsulfonyl chloride, benzenesulfonyl chloride, 4-acetylamino, acetylsulfanilyl chloride, p-acetamidobenzenesulfonyl chloride, n-acetylsulphanilyl chloride, p-acetaminobenzenesulfonyl chloride | |
| GRDXCFKBQWDAJH-UHFFFAOYSA-N | |
| 4-acetamidobenzenesulfonyl chloride | |
| 8481 | |
| 99% | |
| N-Acetylsulfanilyl chloride, 99% |
| 98.5 | |
| 145.0°C to 148.0°C | |
| >112°C | |
| 98.5% min. (Argentometry) | |
| C8H8ClNO3S | |
| MFCD00007442 | |
| 14, 702 | |
| 15, 95 | |
| Solubility in water: insoluble. Other solubilities: soluble in chloroform,ethylene dichloride,,alcohol,ether | |
| CC(=O)NC1=CC=C(C=C1)S(Cl)(=O)=O | |
| 233.67 | |
| 233.67 | |
| Granular Crystalline Powder or Crystals |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
GHS P Statement
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if pre
GHS Signal Word: Danger
EINECSNumber : 204-485-1
RTECSNumber : DB8837500
TSCA : TSCA
RUO – Research Use Only