missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
N-Acetyl-L-leucine 99.0+%, TCI America™
$66.37 - $142.67
Chemical Identifiers
| CAS | 1188-21-2 |
|---|---|
| Molecular Formula | C8H15NO3 |
| Molecular Weight (g/mol) | 173.21 |
| MDL Number | MFCD00065131 |
| InChI Key | WXNXCEHXYPACJF-JLDDOWRYNA-N |
| Synonym | n-acetyl-l-leucine, acetyl-l-leucine, ac-leu-oh, n-acetylleucine, s-2-acetamido-4-methylpentanoic acid, n-acetyl-leu, 2s-2-acetamido-4-methylpentanoic acid, n-acetyl-leucine, leucine, n-acetyl-, l, n-acetyl-l-leucin |
| PubChem CID | 70912 |
| ChEBI | CHEBI:17786 |
| IUPAC Name | (2S)-2-acetamido-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(C)=O)C(O)=O |
Chemical Identifiers
| 1188-21-2 | |
| 173.21 | |
| WXNXCEHXYPACJF-JLDDOWRYNA-N | |
| 70912 | |
| (2S)-2-acetamido-4-methylpentanoic acid |
| C8H15NO3 | |
| MFCD00065131 | |
| n-acetyl-l-leucine, acetyl-l-leucine, ac-leu-oh, n-acetylleucine, s-2-acetamido-4-methylpentanoic acid, n-acetyl-leu, 2s-2-acetamido-4-methylpentanoic acid, n-acetyl-leucine, leucine, n-acetyl-, l, n-acetyl-l-leucin | |
| CHEBI:17786 | |
| CC(C)C[C@H](NC(C)=O)C(O)=O |
Specifications
| 1188-21-2 | |
| White | |
| MFCD00065131 | |
| n-acetyl-l-leucine, acetyl-l-leucine, ac-leu-oh, n-acetylleucine, s-2-acetamido-4-methylpentanoic acid, n-acetyl-leu, 2s-2-acetamido-4-methylpentanoic acid, n-acetyl-leucine, leucine, n-acetyl-, l, n-acetyl-l-leucin | |
| CC(C)C[C@H](NC(C)=O)C(O)=O | |
| 173.21 | |
| CHEBI:17786 | |
| ≥99.0% (T) | |
| N-Acetyl-L-leucine |
| 185°C | |
| C8H15NO3 | |
| 5 g | |
| WXNXCEHXYPACJF-JLDDOWRYNA-N | |
| (2S)-2-acetamido-4-methylpentanoic acid | |
| 70912 | |
| 173.21 | |
| Crystalline Powder |
Safety and Handling
TSCA : Yes