missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
N-acetyl-L-arginine dihydrate, >99%, MP Biomedicals™
Manufacturer: Mp Biomedicals 10007810
Specifications
| N-acetyl-L-arginine dihydrate | |
| >99% | |
| MFCD00019733 | |
| SNEIUMQYRCDYCH-LURJTMIESA-N | |
| (2S)-2-acetamido-5-(diaminomethylideneamino)pentanoic acid | |
| 67427 | |
| 252.27 | |
| White |
| 155-84-0 | |
| C8H16N4O3 | |
| ac-arg-oh | |
| CC(=O)NC(CCCN=C(N)N)C(=O)O | |
| 216.241 | |
| CHEBI:40521 | |
| Powder | |
| 10g |
Chemical Identifiers
| 155-84-0 | |
| 216.241 | |
| SNEIUMQYRCDYCH-LURJTMIESA-N | |
| 67427 | |
| (2S)-2-acetamido-5-(diaminomethylideneamino)pentanoic acid |
| C8H16N4O3 | |
| MFCD00019733 | |
| ac-arg-oh | |
| CHEBI:40521 | |
| CC(=O)NC(CCCN=C(N)N)C(=O)O |
Safety and Handling
EINECSNumber : 205-846-6