missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
N-(1-naphthyl)ethylene-diamine, MP Biomedicals™
$146.16 - $407.59
Chemical Identifiers
| CAS | 1465-25-4 |
|---|---|
| Molecular Formula | C12H16Cl2N2 |
| Molecular Weight (g/mol) | 259.174 |
| InChI Key | MZNYWPRCVDMOJG-UHFFFAOYSA-N |
| Synonym | 1,2-ethanediamine, n-1-naphthalenyl-, dihydrochloride, 2-1-naphthylamino ethylamine 2hcl, bratton-marshall reagent, ccris 425, marshall's reagent, n-1-naphthalenyl-1,2-ethanediamine dihydrochloride, n-1-naphthyl ethylenediamine dihydrochloride, n-1-naphthylethylenediamine dihydrochloride, n1-naphthalen-1-yl ethane-1,2-diamine dihydrochloride, unii-h734599kjl |
| PubChem CID | 15106 |
| ChEBI | CHEBI:53452 |
| IUPAC Name | N'-naphthalen-1-ylethane-1,2-diamine;dihydrochloride |
| SMILES | C1=CC=C2C(=C1)C=CC=C2NCCN.Cl.Cl |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
ICN10239725
|
Mp Biomedicals
0210239725 |
25g |
Each for $146.16
|
|
ICN10239780
|
Mp Biomedicals
0210239780 |
100g |
Each for $407.59
|
|
Chemical Identifiers
| 1465-25-4 | |
| 259.174 | |
| 1,2-ethanediamine, n-1-naphthalenyl-, dihydrochloride, 2-1-naphthylamino ethylamine 2hcl, bratton-marshall reagent, ccris 425, marshall's reagent, n-1-naphthalenyl-1,2-ethanediamine dihydrochloride, n-1-naphthyl ethylenediamine dihydrochloride, n-1-naphthylethylenediamine dihydrochloride, n1-naphthalen-1-yl ethane-1,2-diamine dihydrochloride, unii-h734599kjl | |
| CHEBI:53452 | |
| C1=CC=C2C(=C1)C=CC=C2NCCN.Cl.Cl |
| C12H16Cl2N2 | |
| MZNYWPRCVDMOJG-UHFFFAOYSA-N | |
| 15106 | |
| N'-naphthalen-1-ylethane-1,2-diamine;dihydrochloride |
Specifications
| Tan to White | |
| 1465-25-4 | |
| 1,2-ethanediamine, n-1-naphthalenyl-, dihydrochloride, 2-1-naphthylamino ethylamine 2hcl, bratton-marshall reagent, ccris 425, marshall's reagent, n-1-naphthalenyl-1,2-ethanediamine dihydrochloride, n-1-naphthyl ethylenediamine dihydrochloride, n-1-naphthylethylenediamine dihydrochloride, n1-naphthalen-1-yl ethane-1,2-diamine dihydrochloride, unii-h734599kjl | |
| C1=CC=C2C(=C1)C=CC=C2NCCN.Cl.Cl | |
| 259.174 | |
| CHEBI:53452 | |
| Powder |
| 25g | |
| C12H16Cl2N2 | |
| MZNYWPRCVDMOJG-UHFFFAOYSA-N | |
| N'-naphthalen-1-ylethane-1,2-diamine;dihydrochloride | |
| 15106 | |
| 259.2 | |
| N-(1-Naphthyl)ethylene-diamine |