missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Myricetin, 95%
CAS: 529-44-2 | C15H10O8 | 318.24 g/mol
Supplier: Thermo Scientific Chemicals 151590250
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Myricetin | |
| 529-44-2 | |
| 100.0 | |
| Authentic | |
| Glass bottle | |
| MFCD00006827 | |
| 18, 257 | |
| myricetin, cannabiscetin, myricetol, myricitin, 3,5,7-trihydroxy-2-3,4,5-trihydroxyphenyl-4h-chromen-4-one, 3,3',4',5,5',7-hexahydroxyflavone, 3,5,7,3',4',5'-hexahydroxyflavone, unii-76xc01ftoj, ccris 5838, 3,5,7-trihydroxy-2-3,4,5-trihydroxyphenyl-4h-1-benzopyran-4-one | |
| OC1=CC(O)=C2C(OC(=C(O)C2=O)C2=CC(O)=C(O)C(O)=C2)=C1 | |
| 318.24 | |
| CHEBI:18152 | |
| ≥94% |
| 95% | |
| 94.0 | |
| Brown-Green to Brown-Yellow | |
| 95% | |
| C15H10O8 | |
| 25 mg | |
| 15, 6417 | |
| IKMDFBPHZNJCSN-UHFFFAOYSA-N | |
| 3,5,7-trihydroxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one | |
| 5281672 | |
| 318.23 | |
| Crystalline Powder |
Chemical Identifiers
| 529-44-2 | |
| 318.24 | |
| IKMDFBPHZNJCSN-UHFFFAOYSA-N | |
| 5281672 | |
| 3,5,7-trihydroxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
| C15H10O8 | |
| MFCD00006827 | |
| myricetin, cannabiscetin, myricetol, myricitin, 3,5,7-trihydroxy-2-3,4,5-trihydroxyphenyl-4h-chromen-4-one, 3,3',4',5,5',7-hexahydroxyflavone, 3,5,7,3',4',5'-hexahydroxyflavone, unii-76xc01ftoj, ccris 5838, 3,5,7-trihydroxy-2-3,4,5-trihydroxyphenyl-4h-1-benzopyran-4-one | |
| CHEBI:18152 | |
| OC1=CC(O)=C2C(OC(=C(O)C2=O)C2=CC(O)=C(O)C(O)=C2)=C1 |
RUO – Research Use Only