Learn More
Monensin sodium salt, 90%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 461450010
| Quantity | 1 g |
|---|
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 22373-78-0 | |
| 692.86 | |
| sodium (2S,3R,4S)-4-[(2S,5R,7S,8R,9S)-2-[(2S,2'R,3'S,5R,5'R)-2-ethyl-5'-[(2S,3S,5R,6R)-6-hydroxy-6-(hydroxymethyl)-3,5-dimethyloxan-2-yl]-3'-methyl-[2,2'-bioxolan]-5-yl]-9-hydroxy-2,8-dimethyl-1,6-dioxaspiro[4.5]decan-7-yl]-3-methoxy-2-methylpentanoate |
| C36H61NaO11 | |
| XOIQMTLWECTKJL-FBZUZRIGSA-M | |
| [Na+].CC[C@]1(CC[C@@H](O1)[C@]1(C)CC[C@]2(C[C@H](O)[C@@H](C)[C@H](O2)[C@@H](C)[C@@H](OC)[C@H](C)C([O-])=O)O1)[C@@H]1O[C@H](C[C@@H]1C)[C@H]1O[C@@](O)(CO)[C@H](C)C[C@@H]1C |
Specifications
| Monensin sodium salt | |
| 88 % min. (HPLC) | |
| 1 g | |
| [Na+].CC[C@]1(CC[C@@H](O1)[C@]1(C)CC[C@]2(C[C@H](O)[C@@H](C)[C@H](O2)[C@@H](C)[C@@H](OC)[C@H](C)C([O-])=O)O1)[C@@H]1O[C@H](C[C@@H]1C)[C@H]1O[C@@](O)(CO)[C@H](C)C[C@@H]1C | |
| 692.86 |
| 22373-78-0 | |
| C36H61NaO11 | |
| XOIQMTLWECTKJL-FBZUZRIGSA-M | |
| sodium (2S,3R,4S)-4-[(2S,5R,7S,8R,9S)-2-[(2S,2'R,3'S,5R,5'R)-2-ethyl-5'-[(2S,3S,5R,6R)-6-hydroxy-6-(hydroxymethyl)-3,5-dimethyloxan-2-yl]-3'-methyl-[2,2'-bioxolan]-5-yl]-9-hydroxy-2,8-dimethyl-1,6-dioxaspiro[4.5]decan-7-yl]-3-methoxy-2-methylpentanoate | |
| 692.85 |
Safety and Handling
GHS H Statement Fatal if swallowed.
GHS P Statement Wash face, hands and any exposed skin thoroughly after handling.
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
Rinse mouth.
GHS Signal Word: Danger
EINECSNumber : 244-941-7