missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Mineral Oil, Heavy (USP/FCC), Fisher Chemical™
Saybolt viscosity: 162 minimum
$665.00 - $665.00
Chemical Identifiers
| CAS | 8042-47-5 |
|---|---|
| Molecular Formula | C16H10N2Na2O7S2 |
| Molecular Weight (g/mol) | 452.363 |
| MDL Number | MFCD00131611 |
| InChI Key | AEOVEGJBKQQFOP-DDVLFWKVSA-L |
| Synonym | acid orange 10, wool orange 2g, orange g, c.i. acid orange 10, c.i. orange g, c.i. food orange 4, light orange g, colacid orange g, dolkwal orange g, hexacol orange g |
| PubChem CID | 9566064 |
| IUPAC Name | disodium;(8Z)-7-oxo-8-(phenylhydrazinylidene)naphthalene-1,3-disulfonate |
| SMILES | C1=CC=C(C=C1)NN=C2C(=O)C=CC3=CC(=CC(=C32)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+] |
Description
Saybolt viscosity: 162 minimum
Chemical Identifiers
| 8042-47-5 | |
| 452.363 | |
| AEOVEGJBKQQFOP-DDVLFWKVSA-L | |
| 9566064 | |
| C1=CC=C(C=C1)NN=C2C(=O)C=CC3=CC(=CC(=C32)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+] |
| C16H10N2Na2O7S2 | |
| MFCD00131611 | |
| acid orange 10, wool orange 2g, orange g, c.i. acid orange 10, c.i. orange g, c.i. food orange 4, light orange g, colacid orange g, dolkwal orange g, hexacol orange g | |
| disodium;(8Z)-7-oxo-8-(phenylhydrazinylidene)naphthalene-1,3-disulfonate |
Specifications
| 8042-47-5 | |
| Pass Test (FCC) | |
| 0.83g/mL | |
| 160°C | |
| C16H10N2Na2O7S2 | |
| 4 L | |
| acid orange 10, wool orange 2g, orange g, c.i. acid orange 10, c.i. orange g, c.i. food orange 4, light orange g, colacid orange g, dolkwal orange g, hexacol orange g | |
| AEOVEGJBKQQFOP-DDVLFWKVSA-L | |
| disodium;(8Z)-7-oxo-8-(phenylhydrazinylidene)naphthalene-1,3-disulfonate | |
| 9566064 | |
| <0.1 mmHg | |
| Liquid |
| Pass Test (USP) | |
| White | |
| 260°C | |
| Glass Bottle | |
| MFCD00131611 | |
| 0.845 to 0.905 (FCC/USP) | |
| Meets Requirements (USP) | |
| C1=CC=C(C=C1)NN=C2C(=O)C=CC3=CC(=CC(=C32)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+] | |
| 452.363 | |
| 3 CS min. (FCC), 34.5 to 150.0 mm2.S-1 (USP) | |
| FCC/USP | |
| Mineral Oil, Heavy |
Safety and Handling
CAUTION!
Emergency Overview
May cause eye, skin, and respiratory tract irritation. Ensure adequate ventilation. Wash off immediately with plenty of water for at least 15 minutes. Get medical attention immediately if symptoms occur. Rinse immediately with plenty of water, also under the eyelids, for at least 15 minutes. Obtain medical attention. Move to fresh air. If breathing is difficult, give oxygen. Get medical attention immediately if symptoms occur. Do not induce vomiting. Obtain medical attention. . .
NFPA
Health:0
Flammability:1
Instability:0