Learn More
Mifepristone, 98%, Thermo Scientific Chemicals
Supplier: Thermo Scientific Chemicals 459980050
| Quantity | 5 g |
|---|
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 84371-65-3 | |
| 429.59 | |
| mifepristone, mifeprex, mifegyne, mifepriston, corlux, mifepristona, mifepristonum, korlym, mifepristonum latin, mifepristona spanish | |
| CHEBI:50692 | |
| CC#CC1(CCC2C1(CC(C3=C4CCC(=O)C=C4CCC23)C5=CC=C(C=C5)N(C)C)C)O |
| C29H35NO2 | |
| VKHAHZOOUSRJNA-GCNJZUOMSA-N | |
| 55245 | |
| (8S,11R,13S,14S,17S)-11-[4-(dimethylamino)phenyl]-17-hydroxy-13-methyl-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
Specifications
| Mifepristone | |
| 192.0°C to 198.0°C | |
| 97.5% min. (HPLC) | |
| 5 g | |
| VKHAHZOOUSRJNA-GCNJZUOMSA-N | |
| (8S,11R,13S,14S,17S)-11-[4-(dimethylamino)phenyl]-17-hydroxy-13-methyl-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one | |
| 55245 | |
| 429.59 |
| 84371-65-3 | |
| Authentic | |
| C29H35NO2 | |
| mifepristone, mifeprex, mifegyne, mifepriston, corlux, mifepristona, mifepristonum, korlym, mifepristonum latin, mifepristona spanish | |
| CC#CC1(CCC2C1(CC(C3=C4CCC(=O)C=C4CCC23)C5=CC=C(C=C5)N(C)C)C)O | |
| 429.59 | |
| CHEBI:50692 | |
| 98% |
Safety and Handling
GHS H Statement
May damage fertility or the unborn child.
GHS P Statement
Obtain special instructions before use.
Use personal protective equipment as required.
IF exposed or concerned: Get medical advice/attention.
GHS Signal Word: Danger