Learn More
Methyltriphenylphosphonium Bromide, 98%
CAS: 1779-49-3 | C19H18BrP | 357.23 g/mol
Supplier: Thermo Scientific Chemicals 156951000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
for C-C Bond Formation (Olefination)Specifications
| Methyltriphenylphosphonium bromide | |
| 230.0°C to 234.0°C | |
| >240°C | |
| 97.5% min. (Argentometry) | |
| C19H18BrP | |
| MFCD00011804 | |
| 01,697 | |
| Solubility in water: 400g/L (25°C). Other solubilities: 950g/L methanol (20°C),soluble in aliphatic alcohols and chloroform,practically insoluble in arom. hydrocarbons and,acetone | |
| [Br-].C[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 | |
| 357.23 | |
| 357.22 | |
| Powder |
| 1779-49-3 | |
| White | |
| Authentic | |
| Plastic bottle | |
| CH3P(C6H5)3Br | |
| 100 g | |
| methyltriphenylphosphonium bromide, methyltriphenylphosphanium bromide, triphenylmethylphosphonium bromide, methyl triphenylphosphonium bromide, methyl triphenyl phosphonium bromide, phosphonium, methyltriphenyl-, bromide, methyltriphenylphosphoniumbromide, methyl-triphenyl-phosphonium bromide | |
| LSEFCHWGJNHZNT-UHFFFAOYSA-M | |
| methyl(triphenyl)phosphanium;bromide | |
| 74505 | |
| 98% |
Chemical Identifiers
| 1779-49-3 | |
| 357.23 | |
| LSEFCHWGJNHZNT-UHFFFAOYSA-M | |
| 74505 | |
| [Br-].C[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| C19H18BrP | |
| MFCD00011804 | |
| methyltriphenylphosphonium bromide, methyltriphenylphosphanium bromide, triphenylmethylphosphonium bromide, methyl triphenylphosphonium bromide, methyl triphenyl phosphonium bromide, phosphonium, methyltriphenyl-, bromide, methyltriphenylphosphoniumbromide, methyl-triphenyl-phosphonium bromide | |
| methyl(triphenyl)phosphanium;bromide |
Safety and Handling
GHS H Statement
Toxic if swallowed.
Toxic to aquatic life with long lasting effects.
GHS P Statement
Wash face,hands and any exposed skin thoroughly after handling.
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
GHS Signal Word: Danger
EINECSNumber : 217-218-9
RUO – Research Use Only