missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Methylenediphenyl 4,4'-Diisocyanate 97.0+%, TCI America™
$53.32 - $108.62
Chemical Identifiers
| CAS | 101-68-8 |
|---|---|
| Molecular Formula | C15H10N2O2 |
| Molecular Weight (g/mol) | 250.257 |
| MDL Number | MFCD00036131 |
| InChI Key | UPMLOUAZCHDJJD-UHFFFAOYSA-N |
| Synonym | 4,4'-diphenylmethane diisocyanate, diphenylmethane diisocyanate, isonate, 4,4'-diisocyanatodiphenylmethane, p,p'-diphenylmethane diisocyanate, bis 4-isocyanatophenyl methane, 4,4'-methylenebis phenyl isocyanate, methylbisphenyl isocyanate, 1,1'-methylenebis 4-isocyanatobenzene, methylene diphenyl diisocyanate |
| PubChem CID | 7570 |
| ChEBI | CHEBI:53218 |
| IUPAC Name | 1-isocyanato-4-[(4-isocyanatophenyl)methyl]benzene |
| SMILES | C1=CC(=CC=C1CC2=CC=C(C=C2)N=C=O)N=C=O |
Chemical Identifiers
| 101-68-8 | |
| 250.257 | |
| UPMLOUAZCHDJJD-UHFFFAOYSA-N | |
| 7570 | |
| 1-isocyanato-4-[(4-isocyanatophenyl)methyl]benzene |
| C15H10N2O2 | |
| MFCD00036131 | |
| 4,4'-diphenylmethane diisocyanate, diphenylmethane diisocyanate, isonate, 4,4'-diisocyanatodiphenylmethane, p,p'-diphenylmethane diisocyanate, bis 4-isocyanatophenyl methane, 4,4'-methylenebis phenyl isocyanate, methylbisphenyl isocyanate, 1,1'-methylenebis 4-isocyanatobenzene, methylene diphenyl diisocyanate | |
| CHEBI:53218 | |
| C1=CC(=CC=C1CC2=CC=C(C=C2)N=C=O)N=C=O |
Specifications
| 101-68-8 | |
| White | |
| C15H10N2O2 | |
| 25 g | |
| 4,4'-diphenylmethane diisocyanate, diphenylmethane diisocyanate, isonate, 4,4'-diisocyanatodiphenylmethane, p,p'-diphenylmethane diisocyanate, bis 4-isocyanatophenyl methane, 4,4'-methylenebis phenyl isocyanate, methylbisphenyl isocyanate, 1,1'-methylenebis 4-isocyanatobenzene, methylene diphenyl diisocyanate | |
| C1=CC(=CC=C1CC2=CC=C(C=C2)N=C=O)N=C=O | |
| 250.257 | |
| CHEBI:53218 | |
| ≥97.0% (T) | |
| Methylenediphenyl 4,4′-Diisocyanate |
| 41°C | |
| 184°C | |
| MFCD00036131 | |
| 2206 | |
| UPMLOUAZCHDJJD-UHFFFAOYSA-N | |
| 1-isocyanato-4-[(4-isocyanatophenyl)methyl]benzene | |
| 7570 | |
| 250.26 | |
| Crystalline Powder |
Safety and Handling
EINECSNumber : (4)-0118
RTECSNumber : NQ9350000
TSCA : Yes
Recommended Storage : Refrigerator