missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Methyl Red Sodium Salt, ACS Grade, LabChem™
Supplier: LabChem LC170807
Specifications
| Methyl Red Sodium Salt | |
| 100 | |
| C15H14N3O2Na | |
| Passes Test | |
| CN(C)C1=CC=C(C=C1)N=NC2=CC=CC=C2C(=O)[O-].[Na+] | |
| 291.286 | |
| 291.28 | |
| Amber Glass | |
| Brown/Red | |
| Powder |
| 845-10-3 | |
| C15H14N3NaO2 | |
| Soluble in water | |
| GNTPCYMJCJNRQB-UHFFFAOYSA-M | |
| sodium;2-[[4-(dimethylamino)phenyl]diazenyl]benzoate | |
| 4465632 | |
| ACS | |
| Nitrogen oxides; Carbon monoxide; Carbon dioxide | |
| 10 g |
Chemical Identifiers
| 845-10-3 | |
| 291.286 | |
| 4465632 | |
| CN(C)C1=CC=C(C=C1)N=NC2=CC=CC=C2C(=O)[O-].[Na+] |
| C15H14N3NaO2 | |
| GNTPCYMJCJNRQB-UHFFFAOYSA-M | |
| sodium;2-[[4-(dimethylamino)phenyl]diazenyl]benzoate |
Safety and Handling
GHS H Statement
Product is not hazardous.
GHS P Statement
If in contact with skin or eyes, rinse thoroughly with water for 15-20 minutes.
If swallowed, get medical attention.
Recommended Storage : Room Temperature