missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Methyl Orange, Sodium Salt Grade, ACS Grade, LabChem™
Supplier: LabChem LC169808
Specifications
| Methyl Orange | |
| Sodium Salt Grade | |
| 100 | |
| 4-NaOSO2C6H4N:NC6H4-4-N(CH3)2 | |
| Soluble in water | |
| STZCRXQWRGQSJD-UHFFFAOYSA-M | |
| sodium;4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate | |
| 23673835 | |
| ACS | |
| 1000kg/m3 | |
| Orange | |
| Powder |
| 300°C | |
| 547-58-0 | |
| C14H14N3NaO3S | |
| UN2811 | |
| Passes Test | |
| CN(C)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)S(=O)(=O)[O-].[Na+] | |
| 327.334 | |
| 327.34 | |
| Amber Glass | |
| 1,000kg/m3 | |
| 25 g |
Chemical Identifiers
| 547-58-0 | |
| 327.334 | |
| 23673835 | |
| CN(C)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)S(=O)(=O)[O-].[Na+] |
| C14H14N3NaO3S | |
| STZCRXQWRGQSJD-UHFFFAOYSA-M | |
| sodium;4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate |
Safety and Handling
GHS H Statement
Toxic if swallowed.
GHS P Statement
Wash exposed skin thoroughly after handling.
Do not eat, drink or smoke when using this product.
If swallowed: Rinse mouth.
Immediately call a poison center/doctor.
Store locked up.
Dispose of contents/container to comply with local, state and federal regulations.
Danger
Recommended Storage : Room Temperature