Learn More
Thermo Scientific Chemicals Methyl Orange, ACS
CAS: 547-58-0 | C14H14N3NaO3S | 327.334 g/mol
Supplier: Thermo Scientific Chemicals 01787406
| Quantity | 5 g |
|---|
Description
Methyl orange is a pH indicator frequently used in titrations, also used for histological microscopy.
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 547-58-0 | |
| 327.334 | |
| STZCRXQWRGQSJD-UHFFFAOYSA-M | |
| 23673835 | |
| CN(C)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)S(=O)(=O)[O-].[Na+] |
| C14H14N3NaO3S | |
| MFCD00007502 | |
| Acid Orange 52; C.I. 13025 | |
| sodium;4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate |
Specifications
| Methyl Orange | |
| 547-58-0 | |
| MFCD00007502 | |
| 4732884 | |
| Acid Orange 52; C.I. 13025 | |
| STZCRXQWRGQSJD-UHFFFAOYSA-M | |
| sodium;4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate | |
| 23673835 | |
| ACS | |
| Orange | |
| 5 g |
| >300°C | |
| C14H14N3NaO3S | |
| UN3143 | |
| 14,6105 | |
| Soluble in 500 parts water; More soluble in hot water | |
| CN(C)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)S(=O)(=O)[O-].[Na+] | |
| 327.334 | |
| 327.34 | |
| Weak, characteristic | |
| 6.5 | |
| Crystalline |
Safety and Handling
GHS H Statement
H301
Toxic if swallowed.
P264b-P270-P301+P310-P330-P501c
H301
DOTInformation : Transport Hazard Class: 6.1; Packing Group: III; Proper Shipping Name: DYES, SOLID, TOXIC, N.O.S.
EINECSNumber : 208-925-3
RTECSNumber : DB6327000
TSCA : Yes
Recommended Storage : Ambient temperatures