missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Methyl nervonate, 99%, analytical standard for GC
CAS: 2733-88-2 | C25H48O2 | 380.65 g/mol
Supplier: Thermo Scientific Chemicals 460371000
| Quantity | 100 mg |
|---|
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 2733-88-2 | |
| 380.65 | |
| nervonic acid methyl ester, methyl nervonate, methyl z-tetracos-15-enoate, methyl cis-15-tetracosenoate, selacholeic acid methyl ester, 15-tetracosenoic acid, methyl ester, z, methyl nervonate c24:1, z-methyl tetracos-15-enoate, methyl 15z tetracos-15-enoate, methyl 15z-15-tetracosenoate # | |
| methyl (Z)-tetracos-15-enoate |
| C25H48O2 | |
| AINIZSBLAFHZCP-KHPPLWFESA-N | |
| 5364841 | |
| CCCCCCCCC=CCCCCCCCCCCCCCC(=O)OC |
Specifications
| Methyl nervonate | |
| Authentic | |
| C25H48O2 | |
| 100 mg | |
| AINIZSBLAFHZCP-KHPPLWFESA-N | |
| methyl (Z)-tetracos-15-enoate | |
| 5364841 | |
| 99% |
| 2733-88-2 | |
| 98.5% min. (GC) | |
| CH3(CH2)7CHCH(CH2)13COOCH3 | |
| nervonic acid methyl ester, methyl nervonate, methyl z-tetracos-15-enoate, methyl cis-15-tetracosenoate, selacholeic acid methyl ester, 15-tetracosenoic acid, methyl ester, z, methyl nervonate c24:1, z-methyl tetracos-15-enoate, methyl 15z tetracos-15-enoate, methyl 15z-15-tetracosenoate # | |
| CCCCCCCCC=CCCCCCCCCCCCCCC(=O)OC | |
| 380.65 | |
| 380.65 |
Safety and Handling
EINECSNumber : 220-352-