missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Methyl Heptafluorobutyrate 97.0+%, TCI America™
Supplier: TCI America H10335G
Specifications
| Methyl Heptafluorobutyrate | |
| Colorless | |
| C5H3F7O2 | |
| 5 g | |
| methyl heptafluorobutyrate, methyl heptafluorobutanoate, methyl perfluorobutyrate, methylheptafluorobutyrate, butanoic acid, heptafluoro-, methyl ester, heptafluorobutyric acid methyl ester, butyric acid, heptafluoro-, methyl ester, butanoic acid, 2,2,3,3,4,4,4-heptafluoro-, methyl ester, heptafluorobutyryl methyl ester, methyl perfluorbutanoate | |
| COC(=O)C(C(C(F)(F)F)(F)F)(F)F | |
| 228.066 | |
| 228.07 | |
| Liquid |
| 356-24-1 | |
| 81°C | |
| MFCD00000433 | |
| 3272 | |
| MRPUVAKBXDBGJQ-UHFFFAOYSA-N | |
| methyl 2,2,3,3,4,4,4-heptafluorobutanoate | |
| 67741 | |
| ≥97.0% (GC) |
Chemical Identifiers
| 356-24-1 | |
| 228.066 | |
| MRPUVAKBXDBGJQ-UHFFFAOYSA-N | |
| 67741 | |
| COC(=O)C(C(C(F)(F)F)(F)F)(F)F |
| C5H3F7O2 | |
| MFCD00000433 | |
| methyl heptafluorobutyrate, methyl heptafluorobutanoate, methyl perfluorobutyrate, methylheptafluorobutyrate, butanoic acid, heptafluoro-, methyl ester, heptafluorobutyric acid methyl ester, butyric acid, heptafluoro-, methyl ester, butanoic acid, 2,2,3,3,4,4,4-heptafluoro-, methyl ester, heptafluorobutyryl methyl ester, methyl perfluorbutanoate | |
| methyl 2,2,3,3,4,4,4-heptafluorobutanoate |
Safety and Handling
TSCA : Yes