missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Methyl 4-tert-butylbenzoate, 99%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 173480250
| Quantity | 25g |
|---|---|
| Packaging | Glass bottle |
Description
Chemical Identifiers
| 26537-19-9 | |
| 192.26 | |
| UPIJOAFHOIWPLT-UHFFFAOYSA-N | |
| 97433 | |
| CC(C)(C)C1=CC=C(C=C1)C(=O)OC |
| C12H16O2 | |
| MFCD00008835 | |
| methyl 4-tert-butyl benzoate, methyl p-tert-butylbenzoate, 4-tert-butylbenzoic acid methyl ester, unii-8vk4o27jmt, benzoic acid, 4-1,1-dimethylethyl-, methyl ester, methyl 4-t-butylbenzoate, 8vk4o27jmt, methyl4-tert-butylbenzoate, methyl p-t-butylbenzoate, benzoic acid, p-tert-butyl-, methyl ester | |
| methyl 4-tert-butylbenzoate |
Specifications
| Methyl 4-tert-butylbenzoate | |
| 26537-19-9 | |
| 122.0°C to 124.0°C (9.0 mmHg) | |
| Authentic | |
| Glass bottle | |
| 1.5090 to 1.5110 | |
| 25g | |
| 09, 560 | |
| methyl 4-tert-butyl benzoate, methyl p-tert-butylbenzoate, 4-tert-butylbenzoic acid methyl ester, unii-8vk4o27jmt, benzoic acid, 4-1,1-dimethylethyl-, methyl ester, methyl 4-t-butylbenzoate, 8vk4o27jmt, methyl4-tert-butylbenzoate, methyl p-t-butylbenzoate, benzoic acid, p-tert-butyl-, methyl ester | |
| CC(C)(C)C1=CC=C(C=C1)C(=O)OC | |
| 192.26 | |
| 192.26 |
| 99% | |
| 0.9900g/mL | |
| >110°C | |
| 99% | |
| C12H16O2 | |
| (CH3)3CC6H4CO2CH3 | |
| MFCD00008835 | |
| 0.99 | |
| UPIJOAFHOIWPLT-UHFFFAOYSA-N | |
| methyl 4-tert-butylbenzoate | |
| 97433 | |
| 99% |
Safety and Handling
EINECSNumber : 247-768-5