missing translation for 'onlineSavingsMsg'
Learn More
Please login to your online account to display your discounted pricing
Methyl 3-Methoxy-4-methylbenzoate, TCI America™
Chemical Identifiers
| CAS |
3556-83-0 |
| Molecular Formula |
C10H12O3 |
| Molecular Weight (g/mol) |
180.203 |
| MDL Number |
MFCD00082710 |
| InChI Key |
LLEXCSBUSVRBCA-UHFFFAOYSA-N |
| Synonym |
3-methoxy-4-methylbenzoic acid methyl ester, methyl 3-methoxy-p-toluate, 4-methyl-m-anisic acid methyl ester, benzoic acid, 3-methoxy-4-methyl-, methyl ester, pubchem13650, methyl 4-methyl-m-anisate, acmc-1cs22, methyl3-methoxy-4-methylbenzoate, methyl 3-methoxy-4-methyl-benzoate, 3-methoxy-p-toluic acid methyl ester |
| PubChem CID |
591123 |
| IUPAC Name |
methyl 3-methoxy-4-methylbenzoate |
| SMILES |
CC1=C(C=C(C=C1)C(=O)OC)OC |
View More Specs
Products
2
Specifications
Chemical Identifiers
|
|
3556-83-0 |
|
|
180.203 |
|
|
LLEXCSBUSVRBCA-UHFFFAOYSA-N |
|
|
591123 |
|
|
CC1=C(C=C(C=C1)C(=O)OC)OC |
|
|
C10H12O3 |
|
|
MFCD00082710 |
|
|
3-methoxy-4-methylbenzoic acid methyl ester, methyl 3-methoxy-p-toluate, 4-methyl-m-anisic acid methyl ester, benzoic acid, 3-methoxy-4-methyl-, methyl ester, pubchem13650, methyl 4-methyl-m-anisate, acmc-1cs22, methyl3-methoxy-4-methylbenzoate, methyl 3-methoxy-4-methyl-benzoate, 3-methoxy-p-toluic acid methyl ester |
|
|
methyl 3-methoxy-4-methylbenzoate |
Specifications
|
|
White |
|
|
3556-83-0 |
|
|
MFCD00082710 |
|
|
LLEXCSBUSVRBCA-UHFFFAOYSA-N |
|
|
methyl 3-methoxy-4-methylbenzoate |
|
|
591123 |
|
|
Crystal-Powder at 20°C |
|
|
Methyl 3-Methoxy-4-methylbenzoate |
|
|
5g |
|
|
C10H12O3 |
|
|
3-methoxy-4-methylbenzoic acid methyl ester, methyl 3-methoxy-p-toluate, 4-methyl-m-anisic acid methyl ester, benzoic acid, 3-methoxy-4-methyl-, methyl ester, pubchem13650, methyl 4-methyl-m-anisate, acmc-1cs22, methyl3-methoxy-4-methylbenzoate, methyl 3-methoxy-4-methyl-benzoate, 3-methoxy-p-toluic acid methyl ester |
|
|
CC1=C(C=C(C=C1)C(=O)OC)OC |
|
|
180.203 |
|
|
180.20 |
|
|
≥98.0% (GC) |
Safety and Handling
