missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Methyl 3-Methoxy-4-methylbenzoate 98.0+%, TCI America™
$63.67 - $163.72
Chemical Identifiers
| CAS | 3556-83-0 |
|---|---|
| Molecular Formula | C10H12O3 |
| Molecular Weight (g/mol) | 180.203 |
| MDL Number | MFCD00082710 |
| InChI Key | LLEXCSBUSVRBCA-UHFFFAOYSA-N |
| Synonym | 3-methoxy-4-methylbenzoic acid methyl ester, methyl 3-methoxy-p-toluate, 4-methyl-m-anisic acid methyl ester, benzoic acid, 3-methoxy-4-methyl-, methyl ester, pubchem13650, methyl 4-methyl-m-anisate, acmc-1cs22, methyl3-methoxy-4-methylbenzoate, methyl 3-methoxy-4-methyl-benzoate, 3-methoxy-p-toluic acid methyl ester |
| PubChem CID | 591123 |
| IUPAC Name | methyl 3-methoxy-4-methylbenzoate |
| SMILES | CC1=C(C=C(C=C1)C(=O)OC)OC |
Chemical Identifiers
| 3556-83-0 | |
| 180.203 | |
| LLEXCSBUSVRBCA-UHFFFAOYSA-N | |
| 591123 | |
| CC1=C(C=C(C=C1)C(=O)OC)OC |
| C10H12O3 | |
| MFCD00082710 | |
| 3-methoxy-4-methylbenzoic acid methyl ester, methyl 3-methoxy-p-toluate, 4-methyl-m-anisic acid methyl ester, benzoic acid, 3-methoxy-4-methyl-, methyl ester, pubchem13650, methyl 4-methyl-m-anisate, acmc-1cs22, methyl3-methoxy-4-methylbenzoate, methyl 3-methoxy-4-methyl-benzoate, 3-methoxy-p-toluic acid methyl ester | |
| methyl 3-methoxy-4-methylbenzoate |
Specifications
| White | |
| 3556-83-0 | |
| MFCD00082710 | |
| LLEXCSBUSVRBCA-UHFFFAOYSA-N | |
| methyl 3-methoxy-4-methylbenzoate | |
| 591123 | |
| Crystal-Powder at 20°C | |
| Methyl 3-Methoxy-4-methylbenzoate |
| 5g | |
| C10H12O3 | |
| 3-methoxy-4-methylbenzoic acid methyl ester, methyl 3-methoxy-p-toluate, 4-methyl-m-anisic acid methyl ester, benzoic acid, 3-methoxy-4-methyl-, methyl ester, pubchem13650, methyl 4-methyl-m-anisate, acmc-1cs22, methyl3-methoxy-4-methylbenzoate, methyl 3-methoxy-4-methyl-benzoate, 3-methoxy-p-toluic acid methyl ester | |
| CC1=C(C=C(C=C1)C(=O)OC)OC | |
| 180.203 | |
| 180.20 | |
| ≥98.0% (GC) |
Safety and Handling
TSCA : No