Learn More
(Methoxymethyl)triphenylphosphonium chloride, 98%
CAS: 4009-98-7 | C20H20ClOP | 342.80 g/mol
$119.40 - $308.87
Chemical Identifiers
| CAS | 4009-98-7 |
|---|---|
| Molecular Formula | C20H20ClOP |
| Molecular Weight (g/mol) | 342.80 |
| MDL Number | MFCD00011800 |
| InChI Key | SJFNDMHZXCUXSA-UHFFFAOYSA-M |
| Synonym | methoxymethyl triphenylphosphonium chloride, methoxymethyl triphenylphosphanium chloride, phosphonium, methoxymethyl triphenyl-, chloride, methoxymethyltriphenylphosphonium chloride, methoxymethyl-triphenylphosphonium chloride, methoxymethyl-triphenyl-phosphonium chloride, triphenyl methoxymethyl phosphonium chloride, methoxy methyl triphenyl phosphonium chloride |
| PubChem CID | 2723798 |
| IUPAC Name | methoxymethyl(triphenyl)phosphanium;chloride |
| SMILES | [Cl-].COC[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC146010250
|
Thermo Scientific Chemicals
146010250 |
25 g | Glass bottle |
N/A
|
|
||||
|
AC146011000
|
Thermo Scientific Chemicals
146011000 |
100 g | Glass bottle |
N/A
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
For C-C Bond Formation (Olefination)Chemical Identifiers
| 4009-98-7 | |
| 342.80 | |
| SJFNDMHZXCUXSA-UHFFFAOYSA-M | |
| 2723798 | |
| [Cl-].COC[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| C20H20ClOP | |
| MFCD00011800 | |
| methoxymethyl triphenylphosphonium chloride, methoxymethyl triphenylphosphanium chloride, phosphonium, methoxymethyl triphenyl-, chloride, methoxymethyltriphenylphosphonium chloride, methoxymethyl-triphenylphosphonium chloride, methoxymethyl-triphenyl-phosphonium chloride, triphenyl methoxymethyl phosphonium chloride, methoxy methyl triphenyl phosphonium chloride | |
| methoxymethyl(triphenyl)phosphanium;chloride |
Specifications
| 4009-98-7 | |
| 100.0 | |
| White | |
| >250°C | |
| 97.5% min. (HPLC) | |
| C20H20ClOP | |
| MFCD00011800 | |
| methoxymethyl triphenylphosphonium chloride, methoxymethyl triphenylphosphanium chloride, phosphonium, methoxymethyl triphenyl-, chloride, methoxymethyltriphenylphosphonium chloride, methoxymethyl-triphenylphosphonium chloride, methoxymethyl-triphenyl-phosphonium chloride, triphenyl methoxymethyl phosphonium chloride, methoxy methyl triphenyl phosphonium chloride | |
| SJFNDMHZXCUXSA-UHFFFAOYSA-M | |
| methoxymethyl(triphenyl)phosphanium;chloride | |
| 2723798 | |
| 98% | |
| (Methoxymethyl)triphenylphosphonium chloride, 98% |
| 97.5 | |
| 195.0°C to 197.0°C | |
| 413.0°C | |
| Authentic | |
| Glass bottle | |
| CH3OCH2P(C6H5)3Cl | |
| 25 g | |
| Solubility in water: decomposes | |
| [Cl-].COC[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 | |
| 342.80 | |
| 342.79 | |
| Crystalline Powder |
Safety and Handling
GHS H Statement
Toxic to aquatic life with long lasting effects.
Causes skin irritation.
Harmful if swallowed.
Causes serious eye irritation.
GHS P Statement
IF ON SKIN: Wash with plenty of soap and water.
Avoid release to the environment.
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
Wear protective gloves/protective clothing/eye protection/f
GHS Signal Word: Warning
EINECSNumber : 223-664-5
TSCA : TSCA
RUO – Research Use Only