missing translation for 'onlineSavingsMsg'
Learn More
Learn More
meso-2,3-Dibromosuccinic acid, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 147575000
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| meso-2,3-Dibromosuccinic acid | |
| Authentic | |
| Plastic bottle | |
| HO2CCH(Br)CH(Br)CO2H | |
| 500g | |
| 14,3029 | |
| Solubility in water: 20g/L (17°C). Other solubilities: soluble in alcohol and ether, sparingly soluble in chloroform | |
| [O-]C(=O)[C@@H](Br)[C@@H](Br)C([O-])=O | |
| 273.87 | |
| 275.88 |
| 608-36-6 | |
| 98% | |
| C4H2Br2O4 | |
| MFCD00066439 | |
| 02,625 | |
| 2r,3s-2,3-dibromosuccinic acid, meso-2,3-dibromosuccinic acid, unii-d2ii9ugq9x, d2ii9ugq9x, butanedioic acid, 2,3-dibromo-, 2r,3s-rel, 2r,3s-rel-2,3-dibromosuccinic acid, 2r,3s-2,3-dibromobutanedioic acid, meso-dibromosuccinic acid, 2,3-dibromosuccinic acid, meso, 2,3-dibromosuccinic acid meso-form mi | |
| FJWGRXKOBIVTFA-XIXRPRMCSA-L | |
| (2S,3R)-2,3-dibromobutanedioic acid | |
| 641611 | |
| 98% |
Chemical Identifiers
| 608-36-6 | |
| 273.87 | |
| FJWGRXKOBIVTFA-XIXRPRMCSA-L | |
| 641611 | |
| [O-]C(=O)[C@@H](Br)[C@@H](Br)C([O-])=O |
| C4H2Br2O4 | |
| MFCD00066439 | |
| 2r,3s-2,3-dibromosuccinic acid, meso-2,3-dibromosuccinic acid, unii-d2ii9ugq9x, d2ii9ugq9x, butanedioic acid, 2,3-dibromo-, 2r,3s-rel, 2r,3s-rel-2,3-dibromosuccinic acid, 2r,3s-2,3-dibromobutanedioic acid, meso-dibromosuccinic acid, 2,3-dibromosuccinic acid, meso, 2,3-dibromosuccinic acid meso-form mi | |
| (2S,3R)-2,3-dibromobutanedioic acid |
Safety and Handling
GHS Signal Word: Warning
RUO â Research Use Only