missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Maltitol, 95%
CAS: 585-88-6 | C12H24O11 | 344.32 g/mol
Supplier: Thermo Scientific Chemicals 295800250
| Quantity | 25 g |
|---|---|
| Packaging | Glass bottle |
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 585-88-6 | |
| 344.32 | |
| VQHSOMBJVWLPSR-WUJBLJFYSA-N | |
| 493591 | |
| (2S,3R,4R,5R)-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,3,5,6-pentol |
| C12H24O11 | |
| MFCD00006600 | |
| maltitol, d-maltitol, maltisorb, malbit, amalti syrup, malti mr, amalty mr 100, amalty, 4-o-alpha-d-glucopyranosyl-d-glucitol, unii-d65dg142wk | |
| CHEBI:68428 | |
| C(C1C(C(C(C(O1)OC(C(CO)O)C(C(CO)O)O)O)O)O)O |
Specifications
| Maltitol | |
| 585-88-6 | |
| White | |
| 94% min. (ELSD) (HPLC) | |
| C12H24O11 | |
| MFCD00006600 | |
| + 107.00 (20.00°C c=5,water) | |
| maltitol, d-maltitol, maltisorb, malbit, amalti syrup, malti mr, amalty mr 100, amalty, 4-o-alpha-d-glucopyranosyl-d-glucitol, unii-d65dg142wk | |
| VQHSOMBJVWLPSR-WUJBLJFYSA-N | |
| (2S,3R,4R,5R)-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,3,5,6-pentol | |
| 493591 | |
| 344.32 | |
| Crystalline Powder |
| 95% | |
| 147°C to 153°C | |
| Authentic | |
| Glass bottle | |
| 25 g | |
| 17, V,7, 145 | |
| + 107 | |
| (10% in water) Clear colorless | |
| C(C1C(C(C(C(O1)OC(C(CO)O)C(C(CO)O)O)O)O)O)O | |
| 344.32 | |
| CHEBI:68428 | |
| 95% |
Safety and Handling
EINECSNumber : 209-567-0
RTECSNumber : LZ4394000
TSCA : TSCA